Suppose Lauren is working two jobs to help pay for college. One job pays more per hour than the other. Since her boss at the higher-paying job wouldn't give her as many hours as she wanted, she picked up the second job to generate more income. With her course load, 20 hours a week of work is all she can manage, but she wants to make as much money as possible in those 20 hours. Her goal is to get twice as many hours a week at the higher-paying job than at the lower-paying one. How many hours should she work at each job

Answers

Answer 1

Answer:

She will work 6.67 hours at the low paying job and 13.33 hours at the high paying job

Step-by-step explanation:

Given

[tex]x = Low\ pay\ job[/tex]

[tex]y = high\ pay\ job[/tex]

From the question, we have that:

She can only work for 20 hours.

This implies that:

[tex]x + y= 20[/tex]

To work 2ce as many hours at the high paying job than the low paying job; implies that:

[tex]y = 2x[/tex]

So, we have:

[tex]x + y= 20[/tex]

[tex]y = 2x[/tex]

Required

Number of hours at each job

Substitute [tex]y = 2x[/tex] in [tex]x + y= 20[/tex]

[tex]x + 2x = 20[/tex]

[tex]3x =20[/tex]

Solve for x

[tex]x = \frac{20}{3}[/tex]

[tex]x = 6.67[/tex]

Substitute [tex]x = \frac{20}{3}[/tex] in [tex]y = 2x[/tex]

[tex]y = 2 * \frac{20}{3}[/tex]

[tex]y = \frac{40}{3}[/tex]

[tex]y = 13.33[/tex]

She will work 6.67 hours at the low paying job and 13.33 hours at the high paying job


Related Questions

Gym A charges a registration fee of $75 plus $35.75 per month for members. Gym B charges a registration fee of $164 plus $17.95 for members. After how many months would the total cost at Gym A and Gym B be the same for members?

Answers

Five months
Reason: graph y=35.75x+75 and y=17.95x+164 and they connect in the middle of 253-254 for month 5

Solve system pls

x=y-7 5x-5y=-35

10 pts

Answers

Answer:

x=y-75x-5y=-35

Step-by-step explanation:

Select the graph that represents the given set. (Click on the graph until the correct one is showing.)

E = {(6, 2), (7, 3), (6, -1), (5, 4)}

Answers

Answer:

Hi! The answer is in the pic below!!

Step-by-step explanation:

☆*: .。..。.:*☆☆*: .。..。.:*☆☆*: .。..。.:*☆☆*: .。..。.:*☆

☆Brainliest is greatly appreciated!☆

Hope this helps!!

- Brooklynn Deka

12239.32=6000(1.02)³⁶​

Answers

Answer:

That's false

Step-by-step explanation:

6000(1.02)³⁶​ = 2.1 × 10¹³⁶

sin(a-30)-sin(a+30)=-coss​

Answers

Answer:

We know that:

Sin(a + b) = sin(a)*cos(b) + sin(b)*cos(a)

Then if we use this property in our expression:

sin(a-30)-sin(a+30)

We get:

sin(a)*cos(-30°) + sin(-30°)*cos(a) - sin(a)*cos(30°) - sin(30°)*cos(a)

Now remember that:

sin(-x) = -sin(x)

and

cos(-x) = cos(x)

Then we can rewrite our expression as:

sin(a)*cos(30°) - sin(30°)*cos(a) - sin(a)*cos(30°) - sin(30°)*cos(a)

= -2*sin(30°)*cos(a)

and sin(30°) = 0.5

Then:

-2*sin(30°)*cos(a) = -2*0.5*cos(a) = -cos(a)

So we get:

sin(a-30)-sin(a+30)= - cos(a)

For which equations does 38 make the equation true? Choose all that apply. A. 4/8+□=7/8 B. 1 1/8−□=1 C. 1 1/8+□=4 1/8 D. 1 6/8−□=1 3/8

Answers

The Link given in the other answer is a SCAM don’t click on it

Carmen made $247 for 13 hours of work.
At the same rate, how many hours would she have to work to make $171?

Answers

Answer:

9 hours

Step-by-step explanation:

$247/13hours=$19 per hour

$171/$19=9 hours

plz help for a brianly

Answers

Answer:

Heyyyyy! Help with what?

Step-by-step explanation:

Let me know :)

Have a nice day <3

The table below represents the closing prices of stock TUV for the first five
days it was open. Using your calculator, what is the equation of exponential
regression that fits these data?
Day
1
2
3
WN
Value
3.938
6.891
12.059
21.103
36.929
4
5
A. y = 2.25. 1.75%
B. y = 2.85.1.55%
C. y = 2.75 1.25%
D. y = 2.55.175

Answers

The answer is A the y=2.25

The equation of the exponential regression that fits these data,

y = 2.25 [tex](1.75)^x[/tex]

What is Exponential regression?

It is a model that explains processes that increase at twice the rate. It is employed in circumstances where growth starts slowly but quickly accelerates without bounds, or decay starts quickly but slows down to zero.

The formula for expressing Exponential Regression is

y = a[tex]b^x[/tex]

We have given that,

The table below represents The closing prices of stock at TUV for the last five days

Days      Value

1           3.938

2          6.891

3          12.059

4          21.103

5          36.929

First we have to find r as

r= 6.891/ 3.938

r = 1.749

As, the standard form of Exponential function

y = a[tex]b^x[/tex]

So, y = 2.25 [tex](1.75)^x[/tex]

learn more about linear regression here:

brainly.com/question/25987747

#SPJ7

I WILL MARK BRAINLY HELP ME PLEASE! :)

Answers

Answer:

1. right

2. acute

3. obtuse

4. obtuse

5. acute

6. acute

7. scalene

8. scalene

9. isosceles

10. equilateral

11. scalene

12. isosceles

Step-by-step explanation:

All I know it’s not D and i’m super confused and I just want to go to bed

Answers

Answer:

C.

Step-by-step explanation:

Before graphing this equation we first need to isolate y on one side like so...

y + 2 = 3(x+1)   ... distribute the 3 to both values inside the parenthesis

y + 2 = 3x + 3   ... subtract 2 on both sides

y = 3x + 1

Now that we have the y variable isolated we see that the slope of the function is 3, meaning that for every 1 unit right the line needs to move 3 units up. We also have the value where the line needs to cross the y-axis and that is 1. Using this information we see that the correct graph is C.

A.11.1

B.12.7

C.9.2

D.8.5

Answers

Answer: B. 12.7

Step-by-step explanation:

Answer:

D.8.5

Step-by-step explanation:

38.4/2=

19.2 L

19.2-10.7=

8.5

hope this helps ; )

PLEASE HELP I DONT UNDERSTAND THIS AND ITS DUE TODAY *10 POINTS*

Answers

Answer:

third side = 7

Step-by-step explanation:

x² = 9² - (4√2)² = 81 - 32 = 49

x = √49 = 7

Melinda is planning to attend a private university after she graduates from high school in 3 years. She is devising a plan to save money each month to help with the expenses of attending the university. The cost of attending the private university for one year is $22,500. Her family has promised to contribute $13,500 each year she is in school. Which plan shows the minimum amount of money Melinda must contribute to her savings to have enough money to pay for her first year of tuition? A: save $250 per month for the next 3 years B: Save $375 per month for the next 3 years C: Save $625 per month for the next 3 years D: Save $750 per month for the next 3 years​

Answers

Answer:

A: save $250 per month for the next 3 years

Step-by-step explanation:

Melinda has three more years in high school as stated in the question.

One year private university tuition = $22,500

Support from family = $13,500

Amount that Melinda has to pay = $22,500 - $13,500 = $9000

Number of months in three years = 3 * 12 = 36 months

If she must save $9000 in 36 months

Then $x  must be saved in 1 month

x = $9000/36

x = $250

The residents of a certain dormitory have collected the following data: People who live in the dorm can be classified as either involved in a relationship or uninvolved. Among involved people, 15 percent experience a breakup of their relationship every month. Among uninvolved people, 15 percent enter into a relationship every month. What is the steady-state percentage of residents who are uninvolved

Answers

Answer:

the steady-state percentage of residents who are uninvolved is 0.5

Step-by-step explanation:

 Given the data in the question;

let N represent total number of people in the dormitory

I represent  people involved in a relationship

and U represent people uninvolved in a relationship.

so

N = I + U

I = N - U ------ let this be equation 1

Rate of Uninvolved = U/N

now, given that rate of break ups B = 15% every month = 0.15

rate of entering into relationship  R = 15% every month = 0.15

Now, the steady state condition is;

RU = BI ------- let this be equation 2

such that uninvolved rate is constant.

we input equation 1 into 2;

RU = B( N - U  )

we divide both sides by N

RU/N = B( N/N - U/N  )

RU/N = B( 1 - U/N  )

U/N = B / (B + R)

so we substitute

U/N = 0.15 / (0.15 + 0.15)

U/N = 0.15 / 0.3

U/N = 0.5

Therefore, the steady-state percentage of residents who are uninvolved is 0.5

What is the volume of water in the trough in cubic feet when the trough is full

Answers

Answer is in a photo. I can only upload[tex]^{}[/tex] it to a file hosting service. link below!

bit.[tex]^{}[/tex]ly/3tZxaCQ

look at pic 10 pts will mark brainilest

Answers

It would be D .........

is 6.7 and 6.40 equal?

Answers

Answer:

no

Step-by-step explanation:

Zero is Soo's miserly number. It won't give the number four

Plsss help mark brain list

Answers

Answer:

59

Step-by-step explanation:

360 - ( 156 + 86 ) = 118

118 / 2 = 59

express the following in a a+bi form.
(3 – i)(4 + 7i) – ((5 – i) – 2(1 – 3i))

Answers

Answer:

16+12i

Step-by-step explanation:

Conce
Unknown to a medical researcher, 9 out of 20 patients have a heart problem that will result in death if they receive the test drug. 8 patients are randomly selected to
receive the drug and the rest receive a placebo. What is the probability that exactly 6 patients will die? Express your answer as a fraction or a decimal number rounded to
four decimal places.

Answers

Answer:

0.0367 = 3.67% probability that exactly 6 patients will die

Step-by-step explanation:

The patients are chosen without replacement, which means that the hypergeometric distribution is used to solve this question.

Hypergeometric distribution:

The probability of x sucesses is given by the following formula:

[tex]P(X = x) = h(x,N,n,k) = \frac{C_{k,x}*C_{N-k,n-x}}{C_{N,n}}[/tex]

In which:

x is the number of sucesses.

N is the size of the population.

n is the size of the sample.

k is the total number of desired outcomes.

Combinations formula:

[tex]C_{n,x}[/tex] is the number of different combinations of x objects from a set of n elements, given by the following formula.

[tex]C_{n,x} = \frac{n!}{x!(n-x)!}[/tex]

In this question, we have that:

20 patients means that [tex]N = 20[/tex]

Sample of 8 means that [tex]n = 8[/tex]

9 have the heart problem, so [tex]k = 9[/tex]

What is the probability that exactly 6 patients will die?

This is P(X = 6).

[tex]P(X = x) = h(x,N,n,k) = \frac{C_{k,x}*C_{N-k,n-x}}{C_{N,n}}[/tex]

[tex]P(X = 6) = h(6,20,8,9) = \frac{C_{9,6}*C_{11,2}}{C_{20,8}} = 0.0367[/tex]

0.0367 = 3.67% probability that exactly 6 patients will die

what is the answer?
8 x 1/2 = ______

Answers

Answer:

4

Step-by-step explanation:

Another way to write this is 8/1 x 1/2. Then the answer would be 8/2. Simplify to get 4.

8 × 1/2 = 4!

Calculation steps:

8 ×

1

2

= 8 ×

1

2

=

8 × 1

1 × 2

=

8

2

=

8 ÷ 2

2 ÷ 2

= 4

Marcus has a bag of 10
red chips, 15 blue chips,
and 5 black chips. How
many times would he
expect to pick a red chip if
he did the experiment 60
times?
A) 10
B) 20
C) 30
D) 45

PLEASE HELP THIS IS DUE TODAY

Answers

Answer:

B

Step-by-step explanation:

Marcus can expect to have red chip 20 times.

What is probability?

Probability denotes the possibility of the outcome of any random event. The meaning of this term is to check the extent to which any event is likely to happen.

Given that, Marcus has a bag of 10 red chips, 15 blue chips, and 5 black chips.

He did an experiment 60 times and we need to find that how many times would he expect to pick a red chip,

So,

Here the favorable outcomes = red chips (10)

Total outcomes = all the chips = 15+5+10 = 20

So, the probability of finding a red chips for the 60 times = 10/20 x 60

= 30

Hence, Marcus can expect to have red chip 20 times.

Learn more about probability, click;

https://brainly.com/question/30034780

#SPJ2

One week Carlos bought 2 packages of dog bones and 4 packages of cat treats for $18.50. Because the finicky cats didn’t like the cat treats, the next week Carlos returned 3 unopened packages of cat treats and bought 2 more packages of dog bones. After being refunded for the cat treats, Carlos only had to pay $1.00 for his purchase. Based on this information, figure out the price of each item. Explain your reasoning.

Answers

Answer:

1 package of dog bones = 4.875

1 package of cat treats = 2.1875

Step-by-step explanation:

you add the $1 to the 18.50 = 19.50 these are the amount of money for 4 bags of dog food. you take away all the dog food(4) from it = 8.75 divide by 4 for the 4 bags of cat food= 2.1875

sorry I'm very bad at explaining you can put it in your own words

Answer:

Not an answer but OMG

Step-by-step explanation:

I love the Whitty profile pic :)

Solve 3y^3 + 12y^2 + 12y =0

Please

Answers

Answer:

y = 0, -2

Step-by-step explanation:

Factor out the common term 3y.

[tex]3y( {y}^{2} + 4y + 4) = 0[/tex]

Rewrite y² + 4y + 4 in the form of a² + 2ab + b², where a = y and b = 2.

[tex]3y( {y}^{2} + 2(y)(2) + {2}^{2} ) = 0[/tex]

Use square sum: (a + b)² = a² + 2ab + b².

[tex]3y(y + 2) ^{2} = 0[/tex]

solve for y.

y = 0, -2.

therefor, the answer for this equation is 0, - 2.

Please only answer if you're 100% sure it's correct. Thank you. (It's pretty easy.)

Answers

2x-7 and 2+7 are the answers

Simplify: 9^0. I’m a bit confused so can somebody please help me? (:

Answers

Answer:

the answer is 1 because the power of any no. 0 is always 1

PLS HELP!! Katie earned 15% more this week than last week. This week she earned $225, how much did she earn last week?

Answers

Answer:

$258.75

Step-by-step explanation:

225 * 0.15

Let last weeks pay = x

This week she earned 15% more so she earned 100% + 15% more for 115% total.

Setup an equation:

115% times x = $225

115% as a decimal = 1.15

So the equation is:

1.15x = 225

Solve for x by dividing both sides by 1.15:

X = 225/1.15

X = 195.65

Last week she earned $195.65

What is the approximate distance between Chaplain and Asherville?
OA. 30.9 miles
OB.
14.7 miles
O c.
29.8 miles
OD.
16.4 miles

Answers

Answer:

B

Step-by-step explanation:

Remark

I'm hesitant to get an exact answer. You could do that with the cos law for distance. To get an approximate answer you could use the Pythagorean Theorem.

I'll try the cos law first.

Formula

c^2 = a^2 + b^2 - 2abcos(C)

Givens

c = 24

a = 18

b = ?

Solution

24^2 = 18^2 + b^2 - 2*18*b*cos(94)

576 = 324 + b^2 - 36*b*(-0.0698)

0 = 324 - 576 + b^2 + 2.511b

0 = b^2 + 2.511 - 252

Using the quadratic formula, the roots are

b1 = 14.66

b2 = - 17.11

The second one has no meaning in the real world.

Answer

the distance is 14.66 miles from Chaplin to Asherville

Note: using the Pythagorean theorem gives 15.87 which I would count as a good approximation.

Answer:

14.7

Step-by-step explanation:

got 100% on plato

what is the radius of 34.54​

Answers

Answer:

If 34.54 is the diameter then 17.27 is the radius

Step-by-step explanation:

34.54 ÷ 2 = 17.27

Other Questions
Yo plz help no linksHigh _________ and pressure are needed to form a metamorphic rock.a. erosionb. crystallization On-the-job training (OJT) is effective for all but which one of the following situations?A- two cooks who need to be trained on new thermometersB- a longtime employee who needs training on basic pest control proceduresC- a new hire with some experienceD- new rules have been put in place by the health department and all the employees need to be updated If y varies directly as z and inversely as x and y = 18 and z = 3 when x = 6, find y when x = 5 and z = 5.3618964 Why do we need to learn the Metric System anyway?Directions:You will need to post a response based on what you read in the article.In your response, you should choose to answer one of the prompts below.Why should the United States change to the Metric System?What makes the Metric System so great? Compare and contrast the Imperial System (Standard system of measurement) with the Metric System. Define computer memory and write its type Evaluate the expression if k = 5: 2(k + 9) A. 14B. 26C. 16D. 28 -what is the area and perimeter of the trapezoid.-what are the area and perimeter of a trapezoid that is similar to this one but reduced by a linear scale factor of 1/3.- will give you brainliest if its correct HaAAAaAAaaaaAaaAaAaLp King sporting good have tow bikes on sale. One costs $89.98 and another costs $99.99 . What is the difference in the price of these two bikes? Write a function to model set of data Which lifestyle choice would put a person at a higher risk for developing heart disease? A FAMILY HAS 2 THAT EACH HAVE 1\4 POUNDS OF RICE IN THEM. THEY WILL COMBINE THE 2 BAGS AND EQUALLY SHARE ALL OF THE RICE AMONG 3 PEOPLE . HOW MUCH OF THE RICE WILL EACH PERSON RECEIVE the ratio of magazines to books in the library at Gradys school is 2 to 9. which of these is an equivalent ratio?A. 4 to 9B. 10 to 45C. 2 to 18D. 1 to 18 HELPPP TIME RUNNING OUTWhat is Ronald Franzs reaction when he hears that Chris had died?A.He sells all of his possessions and begins a life of wandering.B.He finds Chris family and tells them about his friendship with Chris.C.He funds a scholarship for wilderness studies in Chris name.D.He immediately drives to Alaska to see where Chris had lived.E.He renounces God and drinks a bottle of whiskey, making himself sick. Create a table of values that could represent the function f(x) = 3x + 4. Justify your response. State how can go about finding the etiology of a given infectious disease? PLEASE HELP WITH MY BIOLOGY Explain the effects if the energy from the sun was blocked for 48 hours and how this would relate to the process of photosynthesis. Flight 101, headed straight north, climbed to 30,000 feet and started its cruising speed of 360 mph 10 miles south of the point directly above our location. Flight 222, headed straight west, already cruising at 30,000 feet at 300 mph, was 5 miles east of the point above us at that time. Clearly, the paths of the planes intersect directly above us. Do they collide? Parametrize the linear paths and give the times when they are at the intersection point. By how many seconds do they miss each other? when people are united by common history and culture, they belong to what