Answer:
1 animal cell
2?
3 mircoscope
4?
5 it means whenever you becareful
the process that breaks down rocks
a gas tank is under 1 atm pressure at room temperature. if the temperature halved,what will happen to the pressure
Answer:
The pressure will also be halved.
Explanation:
Gay-Lussac's law states that the relationship between temperature and pressure is directly proportional to each other. If the temperature goes up, so will the pressure.
The “rise” of the muffin is caused by the release of ___________ gas trapped in the mix as it is heated. carbon dioxide hydrogen oxygen helium
Answer:
Carbon dioxide
Explanation:
In the making of the muffins, there are many ingredients are used including flour, egg, butter, sugar, and flavoring of fruits. There is also a raising agent, the baking powder or baking soda used that reacts with the batter.
This reaction form bubbles of carbon dioxide, trapped in the air spaces during the baking and muffin raises. Carbon dioxide makes muffins light, by lifting the batter as it bakes.
Which things are larger than cells? Put an X next to (or highlight) the things that are generally larger than a typical animal or plant cell.
_____thickness of a leaf ____grain of salt
_____atom _____protein molecule
_____width of hair x DNA
_____piece of sawdust _____eye of an ant
_____Water molecule _____tiny seed
_____bread crumb _____larva of a tiny fruit fly
_____bacteria _____period at end of sentence _____ virus
_____speck of pepper _____chromosome _____ frog embryo _____dust mite _____point of a pin _____ flea egg
Answer:
Explanation:
x thickness of a leaf x grain of salt
_____atom _____protein molecule
x width of hair x DNA
x piece of sawdust x eye of an ant
_____Water molecule x tiny seed
x bread crumb x larva of a tiny fruit fly
x bacteria x period at end of sentence _____ virus
x speck of pepper _____chromosome x frog embryo x dust mite xpoint of a pin x flea egg
Determine which equations you would use to solve the following problem: Calculate the amount of heat needed to change 20.0 g of ice at -10.0°C to water at 89.0°C.
Answer:
Q = 4019.4 J
Explanation:
Given data:
Mass of ice = 20.0 g
Initial temperature = -10°C
Final temperature = 89.0°C
Amount of heat required = ?
Solution:
specific heat capacity of ice is 2.03 J/g.°C
Formula:
Q = m.c. ΔT
Q = amount of heat absorbed or released
m = mass of given substance
c = specific heat capacity of substance
ΔT = change in temperature
ΔT = T2 - T1
ΔT = 89.0°C - (-10°C)
ΔT = 99°C
Q = 20.0 g ×2.03 J/g.°C × 99°C
Q = 4019.4 J
Suggest a change of state, other than ice melting, that is an endothermic
process.
Answer:
Vaporization and Sublimation
Explanation:
Answer:
Well there's solid states, liquid states, and gas states in matter.
Which best describes why NH4+ can form an ionic bond with CF?
Its outermost shell gains one or more electrons from CF.
Its positive charge is attracted to the negative charge of Cr.
It has a negative charge that is spread over the entire ion.
It has a nitrogen atom that is strongly attracted to Cr.
Answer:
Its positive charge is attracted to the negative charge of Cl-
Note: The correct question is given below:
Which best describes why NH4+ can form an ionic bond with Cl-?
Its outermost shell gains one or more electrons from Cl-.
Its positive charge is attracted to the negative charge of Cl-.
It has a negative charge that is spread over the entire ion.
It has a nitrogen atom that is strongly attracted to Cl-.
Its positive charge is attracted to the negative charge of Cl-.
Explanation:
An ammonium ion is a positively charged ion which is composed of a molecule of ammonia and a hydrogen ion which are in a coordinate covalent bond due to the lone pair of electrons of the nitrogen atom in the molecule ammonia. The chloride ion however, has an extra electron which gives it a negative charge.
An ionic bond is formed between two oppositely charged ions by a transfer of electrons from one atom to another. It usually occurs between non-metals and metals. However, that formed between ammonium ion and chloride ion is between non-metals entirely.
Due to electrostatic attraction between the oppositely charged ions, an ionic bond is formed between ammonium ion, NH4+, and chloride ion, Cl-.
Which is the molecular shape of water, H20, according to the VSEPR theory?
A. Bent
B. Tetrahedral
C. trigonal pyramidal
D. Trigonal planar
Answer:
the answer is A
Explanation:
For a certain chemical reaction, the bond energy of the reactants is 43 kJ, and 35 kJ of energy is released. For energy to be conserved, what is the bond energy of the products?
Answer:
78kJ
Explanation:
Energy change = Energy in (reactants) - Energy out (products)
According to this question, energy is released, meaning that the reaction is EXOTHERMIC. Hence, the energy change will be negative (-) i.e bond energy of reactants is greater than bond energy of products.
Energy in = bond energy of reactants = 43kJ
Energy out = bond energy of products = ?
Energy change of exothermic reaction = -35kJ
Therefore;
-35kJ = 43kJ - x
x = 35kJ + 43kJ
x = 78kJ
The bond energy of the products is 78kJ.
Analysis of a sample of an oxide of nitrogen gave 47% of nitrogen.What is the empirical formula of the oxide?
Answer:
N2O
Explanation:
hope am right.....
What is arcade in south Center
Answer: game stop and mind games
Explanation:
i live near there
What information can a foliated metamorphic rock provide you about the conditions under which it formed?
Describe how the molecular models you assembled are similar to real molecules.
They model how real molecules are.
Answer:
Atoms models are bigger but they don not match the true or positive way of atoms. to make them visible scientists make their models that resembled with the real ones.
Explanation:
Molecules are microscopic entities and only can be seen under a microscope.
What is the correct name for the following compound: P2Br5
Answer:
Diphosphorus pentabromide is the official name.
Explanation:
Match these solutions with their examples:
Liquid in liquid
Solid in liquid
gas in liquid
gas in gas
solid in solid
liquid in solid
Gas in solid
Examples
A. Air
B. seawater
C. marshmallow
Answer:
sea water
Explanation:
a sea water can match the following
7. Which of the following is unlikely to
happen to zinc?
A) It is rolled into sheets.
B) It is used to coat a steel hull.
C) It is used in a battery.
D) It is used as an insulator.
Answer:D) it is used as an insulator
Explanation:
How are convalent molecules named?
Covalent compounds are named by using numerical prefixes to identify the number of atoms in the molecule. E.g. Mono, Di, tri, tetra, etc.
In the naming, never use mono- for the first element.
The first element keeps its name.
The second element always end in the suffix -ide.
Drop the double vowel for the prefix and the element of the second element in the compound.
Hope this helped!
pls I need help give away 11 points
A particle has a nucleus that contains 10 protons and around the outside it has 8 electrons. What is the overall charge of the particle?
0
+2
-2
+18
Answer:
The charge is +2
Explanation:
Protons are positive, electrons are negative. 10-8=2.
+2 :)
A particle has a nucleus that contains 10 protons and around the outside it has 8 electrons, the overall charge of the particle is +2. Therefore, the correct option is option B.
What is atom?The smallest unit of matter that may be split without producing electrically charged particles is the atom. It is also the smallest piece of substance with chemical element-like characteristics. As a result, the atom serves as the fundamental unit of chemistry.
Space makes up the majority of an atom. The remainder is made up of a cloud of electrons with negative charges around a positive-charged nucleus made up of protons and neutrons. Compared to electrons, that are the lightest positive ions in nature, the nucleus is tiny and dense. A particle has a nucleus that contains 10 protons and around the outside it has 8 electrons, the overall charge of the particle is +2.
Therefore, the correct option is option B.
To know more about atom, here:
https://brainly.com/question/29712157
#SPJ6
How many moles of hydrogen
are in 3.7 moles of C8H11 NO2?
what is the electical charge on the nucleus of the boron atom ?
OK HURRY AND PLEASE ANSWER COZ THIS TEST IS TIMED BROS
What is the sum of the coefficients in the balanced chemical equation for the combustion of acetone, C3H6O(l), in air?
Express answer as an integer
Answer:
C3H6O + 4O2 → 3CO2 + 3H2O or 11
Explanation:
Answer:
11
Explanation:
which description of salt is a chemical property?
No combustion
Odourless
salty taste
solid does not conduct electricity
Answer: No combustion
Explanation:
Helpppppp!!!!! It’s due today
URGENT!!!!!
Answer:
Explanation:
2. a [CO3 2-][H3O+] / [H2O][HCO3-
b. [H2PO4-][H3O+]/[H3PO4][H2O]
What is the pressure inside a 2.0 L bottle filled with 0.25 mol of carbon dioxide gas at 25 °C?
Answer:
3.1atm
Explanation:
Given parameters:
Volume of gas = 2L
Number of moles = 0.25mol
Temperature = 25°C = 25 + 273 = 298K
Unknown:
Pressure of the gas = ?
Solution:
To solve this problem, we use the ideal gas equation.
This is given as;
PV = nRT
P is the pressure
V is the volume
n is the number of moles
R is the gas constant = 0.082atmdm³mol⁻¹K⁻¹
T is the temperature
P = [tex]\frac{nRT}{V}[/tex]
Now insert the parameters and solve;
P = [tex]\frac{0.25 x 0.082 x 298}{2}[/tex] = 3.1atm
Calculate the speed for a car that went a distance of 150 kilometers in 2 hours time. btw this is science
Answer:
The speed of the car is 75 km per hour
Explanation:
Speed is distance over time so 150 km divided by 2 hours is 75km per hour.
Please mark brainliest!!! Thanks.
Choose the balanced chemical equation below that best represents the following reaction:
When baking soda (NaHCO3) reacts with hydrochloric acid (HCl), carbon dioxide bubbles (CO2) are created, along with water (H2O) and sodium chloride (NaCl).
NaCl + H2O → NaHCO3 +CO2 + HCl
CO2 +H2O + NaCl → NaHCO3 + HCl
NaHCO3 + HCl → CO2 + H2O + NaCl
HCl + NaCl + H2O → NaHCO3 +CO2
The balanced chemical equation :
NaHCO₃ + HCl → CO₂ + H₂O + NaCl
Further explanationA balanced chemical reaction shows that the number of atoms of the reactant and the number of atoms of the product is the same
When baking soda (NaHCO3) reacts with hydrochloric acid (HCl), carbon dioxide bubbles (CO2) are created, along with water (H2O) and sodium chloride (NaCl) .
This statement shows that
Reactants (located to the left of the reaction)
Baking soda (NaHCO₃) and Hydrochloric acid (HCl)
product (located to the right of the reaction)
Carbon dioxide(CO₂),water (H₂O) and Sodium chloride (NaCl).
So the reaction :
NaHCO₃ + HCl → CO₂ + H₂O + NaCl
Astronomers observed that the orbit of Uranus was not uniform. Therefore, they hypothesized the existence of another planet. This is an example of scientific investigation being led by _____.
Inductive Reasoning
Deductive Reasoning
Answer:
This is an example of scientific investigation being led by inductive reasoning.
Explanation:
Inductive reasoning is the type of reasoning used to make broad generalizations from specific observations. We have certain pieces of data and make conclusions based on them. In the given example, astronomers have made a specific observation - that the orbit of Uranus isn't uniform. Based on that fact, they made a broader conclusion - that there is another planet. There are probably more things that could lead to the same conclusion.
The opposite is deductive reasoning, where a person starts off with a broad generalization and tries to make specific, logical conclusions based on it.
_________feedback is a type of feedback in which a system is triggered to produce an output.
Answer:
positive
Explanation:
Answer:
Positive feedback is a type of feedback in which a system is triggered to produce an output.
Explanation:
Have a great rest of your day
#TheWizzer
carbon and tin are both in the fourth column of the table which would you expect to have the greater electronegativity
Answer: Carbon
Explanation:
electronegativity decreases when you go down a column
The study of chemical bonds is called chemistry.
The correct answer is carbon.
The more negative charge present on an atom shows the electronegativity.
The attraction of the nucleus to the proton is also referred to as electronegativity.
The smaller the radius more the electronegativity.
Hence, the correct answer is Carbon as it has fewer atoms and a smaller radius.
For more information, refer to the link:-
https://brainly.com/question/12985618
How many molecules are there in 8.25 moles of CaHia?
The number of molecules : 4.967 x 10²⁴
Further explanationA mole is a number of particles(atoms, molecules, ions) in a substance
This refers to the atomic total of the 12 gr C-12 which is equal to 6.02.10²³, so 1 mole = 6.02.10²³ particles
Can be formulated :
N = n x No
N = number of particles
n = mol
No = 6.02.10²³ = Avogadro's number
8.25 moles of C₈H₁₈
The number of molecules :
[tex]\tt 8.25\times 6.02\times 10^{23}=4.967\times 10^{24}[/tex]