point(s) possible
Use the sample data and confidence level given below to complete parts (a) through (d).
A research institute poll asked respondents if they felt vulnerable to identity theft. In the poll, n=1093 and x = 538 who
said "yes." Use a 90% confidence level.
Click the icon to view a table of z scores.
b) Identify the value of the margin of error E.
(Round to three decimal places as needed.)
c) Construct the confidence interval.

(Round to three decimal places as needed.)
d) Write a statement that correctly interprets the confidence interval. Choose the correct answer below.
OA. One has 90% confidence that the interval from the lower bound to the upper bound actually does contain the
true value of the population proportion.
OB. 90% of sample proportions will fall between the lower bound and the upper bound.
C. One has 90% confidence that the sample proportion is equal to the population proportion.
D. There is a 90% chance that the true value of the population proportion will fall between the lower bound and the
upper bound.

Answers

Answer 1
a) Since n = 1093, x = 538, and we are using a 90% confidence level, we can find the standard error of the proportion using the following formula:

standard error = sqrt((p-hat * (1 - p-hat)) / n)

where p-hat is the sample proportion.

Substituting the given values:

p-hat = x / n = 538 / 1093 = 0.4925

standard error = sqrt((0.4925 * (1 - 0.4925)) / 1093)

standard error ≈ 0.015

b) To find the margin of error, we can use the formula:

margin of error = z* * standard error

where z* is the z-score corresponding to the desired confidence level.

Since we are using a 90% confidence level, the z-score is 1.645 (see the table of z-scores).

Substituting the values:

margin of error = 1.645 * 0.015

margin of error ≈ 0.025

Therefore, the margin of error is approximately 0.025.

c) The confidence interval can be constructed using the formula:

confidence interval = p-hat ± margin of error

Substituting the given values:

confidence interval = 0.4925 ± 0.025

confidence interval = (0.4675, 0.5175)

Therefore, the 90% confidence interval for the proportion of people who feel vulnerable to identity theft is (0.4675, 0.5175).

d) The correct statement that interprets the confidence interval is:

OA. One has 90% confidence that the interval from the lower bound to the upper bound actually does contain the true value of the population proportion.

This statement means that if we repeated the sampling process many times and constructed a 90% confidence interval each time, approximately 90% of the intervals would contain the true proportion of people who feel vulnerable to identity theft.

Related Questions

view the photo below. This is timed.

Answers

The other angle that is congruent to  ∠DFA is: ∠BFC

How to identify Congruent angles?

Congruent angles are defined as two or more angles that are said to be identical to each other. This means that the measure of these angles is equal to each other. These type of angles do not make any difference in the congruence of angles, which tells us that they can be acute, obtuse, exterior, or interior angles.

Now, we want to find the angle that is congruent to ∠DFA.

By inspection, we can see that ∠BFC is an opposite angle to ∠DFA.

We know that Opposite angles are the two angles opposite each other when two lines cross. They can also be called vertical angles due to sharing a vertex, which is the point where the two lines connect. Opposite angles always have the same measurement, making them congruent.

Thus, ∠BFC is congruent to  ∠DFA.

Read more about Congruent angles at: https://brainly.com/question/14791175

#SPJ1

please help me, i need it :)

Answers

Chloe can travel 4.4 miles less than Jin on one gallon of gas.

What is a proportional relationship?

A proportional relationship is a type of relationship between two quantities in which they maintain a constant ratio to each other.

The equation that defines the proportional relationship is given as follows:

y = kx.

In which k is the constant of proportionality, representing the increase in the output variable y when the constant variable x is increased by one.

Chloe travels 93 miles on 5 gallons of gas, hence the constant is given as follows:

k = 93/5

k = 18.6 miles per gallon.

Jin's ratio is of 23 miles per gallon, hence he can travel more and the difference is given as follows:

23 - 18.6 = 4.4 miles per gallon.

More can be learned about proportional relationships at https://brainly.com/question/7723640

#SPJ1

Find the range for the set numbers

Answers

Answer:

25

Step-by-step explanation:

range = largest number - smallest number

38-13=25

Find the measure of 3x-46+14=90

Answers

Answer:

Step-by-step explanation:

3x = 90 + 46 - 14

3x = 122

x=[tex]\frac{122}{3}[/tex]≈40,7

Answer: 40.6 repeated

Step-by-step explanation: combine -46 and 14 which is -32. then add 32 to 90. then divide 3 on both sides. 122/3 is 40.6 repeated

Can somebody please help me find poetic elements in this poem fast!!!
Poem: citizenship by Javier Zamora
There’s also an image of the poem

Answers

Some poetic elements found in the poem are:

IronyRepetitionPersonificationMetaphorImagery

What are poetic elements?

Poetic elements are described as  the devices used that characterize a piece of writing as a poem and  are integral to categorise a piece of writing as poetry, such as poetic meter and rhyme scheme.

In the poem, the author uses Imagery which is described as use of sensory details to create vivid mental images in the reader's mind.

The author made use of metaphor as a  comparison between two things that are not alike, in order to create an image or deepen understanding.

Learn more about Poetic elements at:

https://brainly.com/question/21490009

#SPJ1

Calculate how far the village is north of O​

Answers

Step-by-step explanation:

See image

HELPP Billie solved the equation below by completing the square, but she got the incorrect solution. In which step did Billie first make an error?
Step 1 : x 2 + 6 x = 16
Step 2 : x 2 + 6 x + 9 = 16
Step 3 : ( x + 3 ) 2 = 16
Step 4 : x + 3 = ± 4 Step 5 : x = 1 , x = − 7

Answers

Billie made the error in the second step of the equation

How to solve the equation

Billie made an error in Step 2. She added 9 to one sides of the equation, but she should have added 9 to the left side only. The correct steps are as follows:

Step 1: x^2 + 6x = 16

Step 2: x^2 + 6x + 9 = 16 + 9

Step 3: (x + 3)^2 = 25

Step 4: x + 3 = ±√25

Step 5: x = -3 + 5, x = -3 - 5

Step 6: x = 2, x = -8

So, the correct solutions are x = 2 and x = -8.

Read more on equations here:https://brainly.com/question/22688504

#SPJ1

It’s probability and I need your help pls

Answers

The theoretical probabilities are: 0.15, 0.15, and 0.05 respectively

What is probability?

Probability is a branch of mathematics concerned with the analysis of random phenomena

The given parameters that will help us to get the probabilities are

25% are stakeholders

20% have dark hair

The probability of being stakeholders 20%/25%

= 0.20/0.25 = 0.

b)  1-0.8 * 1.0.25

0.2 * 0.75 = 0.15

c.  0.2 * 0.75 = 0.15

d.  Has light hair and is a stakeholder

0.20 * 0.25

= 0.05

Learn more about probabilities on https://brainly.com/question/30034780

#SPJ1

In 1852​, a person sold a house to a lady for ​$30. If the lady had put the ​$30 into a bank account paying ​6% ​interest, how much would the investment have been worth in the year 2012 if interest were compounded in the following​ ways?

Answers

To calculate the value of the investment in the year 2012, we need to know how many years the money was invested. Assuming the investment was made in 1852 and the year 2012, the number of years is 2012 - 1852 = 160.

Compounded annually:
The formula for calculating the future value of an investment with annual compounding is FV = PV x (1 + r)^n, where FV is the future value, PV is the present value, r is the annual interest rate as a decimal, and n is the number of years. Plugging in the values, we get FV = 30 x (1 + 0.06)^160 = $1,342,669.42.

Compounded monthly:
The formula for calculating the future value of an investment with monthly compounding is FV = PV x (1 + r/12)^(n x 12), where FV is the future value, PV is the present value, r is the annual interest rate as a decimal, and n is the number of years. Plugging in the values, we get FV = 30 x (1 + 0.06/12)^(160 x 12) = $1,380,935.15.

Compounded daily:
The formula for calculating the future value of an investment with daily compounding is FV = PV x (1 + r/365)^(n x 365), where FV is the future value, PV is the present value, r is the annual interest rate as a decimal, and n is the number of years. Plugging in the values, we get FV = 30 x (1 + 0.06/365)^(160 x 365) = $1,388,628.12.

HELP ASAP (I chose 34 as random number) (please good explanation because I want to know how to do this well)
The table shows the grading scale for Ms. Gray's social studies class.


A 90%–100%
B 80%–89%
C 70%–79%


Part A: Pick a number between 28 and 39. This number will represent how many points you earned. If you have a pop quiz worth a total of 40 points, using the number you selected, calculate the percentage you earned on the test. Show each step of your work. (8 points)

Part B: Based on the percentage found in Part A, would you earn a grade of A, B, or C using the grading scale provided? Explain your answer. (4 points)

Answers

Your percentage score would be 85% if you completed the quiz and received 34 out of a possible 40 points.

What is a percentage?

A percentage is a means to represent a piece of 100 as a ratio or percentage. The sign for it is % (percent), which stands for "per hundred." If you state, for instance, that 50 out of 100 people like chocolate, then means that 50 out of 100 people, or 0.5 (50/100), like chocolate overall. In several disciplines, including finance, business, mathematics, and statistics, percentages are frequently used.

Part A:

Say we decide to set the number of points gained on the quiz at 40. The following formula is used to determine your percentage score if the quiz was worth a total of 40 points and you received 34 of them:

(Points earned / Total Points) x 100% is the percentage score.

Score in percentage: (34 / 40) x 100%

Score in percentages: 85%

Your percentage score would be 85% if you completed the quiz and received 34 out of a possible 40.

Part B:

You would receive a B on the specified grading scale based on the percentage score of 85%. The percentage score gained in section A falls within the range required for a B grade on the grading scale, which is awarded for percentage scores between 80% and 89%.

To learn more about percentage, visit

brainly.com/question/29306119

#SPJ1

a cuboid with length of 21 cm and height of 16 cm has a volume of 6384 cm3. find its breadth ik

Answers

Answer:18

Step-by-step explanation:18

Find a rational number halfway in between the two numbers.
8/10 and 1/8

Answers

A rational number between 8/10 and 1/8 is 37/80.

We know that a rational number between two rational numbers can be given by finding the average of the two given numbers:

The numbers are 8/10 and 1/8.

Let's simplify the fractions first:

8/10 = 4/5 (dividing both numerator and denominator by 2)

1/8 = 1/8 (already in simplest form)

Average = [tex](\frac{4}{5} + \frac{1}{8})/2[/tex]

         

              = [tex](\frac{(4*8) + (5*1)}{40} )/2[/tex]

 

             = [tex](\frac{37}{40}) /2[/tex]

         

             = [tex]\frac{37}{80}[/tex]

So, the rational number halfway between 8/10 and 1/8 is 37/80.

To know more about rational numbers between two numbers:

https://brainly.com/question/29010316              

The function h(t)=-4t^2+14t+8 gives the height h, in feet, of a football as a function of time t, in seconds, after it is kicked. How long does it take for the football to hit the ground?

Answers

Answer:

t = 4

Step-by-step explanation:

Use the quadratic formula to find the zeros of the function, when h(t) equals 0 that means the ball is touching the ground, giving the maximum time it took for the ball to hit the ground.

[tex]\frac{-b\frac{+}{-} \sqrt{b^2-4*a*c} }{2*a} \\\frac{-14\frac{+}{-} \sqrt{14^2-4*-4*8} }{2*-4} \\t = -0.5,4[/tex]

It takes 4 seconds, since time can not be negative

In circle O, chords AB and CD intersect at E, AE = 3 inches, BE = 8 inches, and CE is 2 inches longer than DE. What is the length of DE, expressed in inches?

Answers

Okay, let's break this down step-by-step:

* Circle O has chords AB and CD that intersect at E

* AE = 3 inches

* BE = 8 inches

* CE is 2 inches longer than DE

So we know:

AE = 3 inches

BE = 8 inches

CE = DE + 2 inches

To find DE, we can use the Pythagorean theorem for any right triangle:

a^2 + b^2 = c^2

In this case:

3^2 + 8^2 = c^2

9 + 64 = 73

c = 8 inches

So the hypotenuse AE forms a right triangle with leg BE of length 8 inches.

Now we have the length of one leg (BE = 8 inches) and the hypotenuse (AE = 8 inches).

We can use the relation between leg, hypotenuse and sine to calculate the other leg (DE):

sin(A) = DE / 8

DE = 8 * sin(A)

Without knowing the angle A, we can make an estimate:

sin(A) ≈ A (for small A)

So DE ≈ 8A inches

Now we know:

CE = DE + 2 inches

And DE ≈ 8A inches

So: 8A + 2 = DE

=> DE = 10A

And since A is small, we can say: DE ≈ 10 * A inches

To summary, if AE = 3 inches and BE = 8 inches,

then DE ≈ 10 * A inches

DE is approximately 10 times some small angle A.

Does this make sense? Let me know if you have any other questions!

help me in 8th grade mathhh

Answers

Answer:

C

Step-by-step explanation:

input y=x+3 into the second equation and solve for x

-2x+y=1

so -2x +x+3 =1

solve for x

x = 2

y= 5

The polygon below is a regular polygon. Find the answer rounded to the nearest tenth.
HELP GIVING BRAINLIST HW DUE SOOON

Answers

Answer:

In a 30°-60°-90° right triangle, the length of the longer leg is √3 times the length of the shorter leg.

A = (1/2)Pa

= (1/2)(2)(8/√3)(6)(8)

= (384√3)/3 = 128√3 = 221.7 units^2

Find the area of the shapes below. Make sure to label your answers with units.
You must show all of your work to receive credit.
Find the area for a

Answers

a) The area of the triangle is 13.3 square units.

b) The area of the rectangle is 57.4 square units.

Let's start with the triangle. The area of a triangle can be calculated by multiplying its base and height and then dividing the result by 2. In your case, the base of the triangle is 7 units and the height is 3.8 units. Therefore, the area of the triangle can be calculated as:

Area of triangle = (Base × Height) ÷ 2

= (7 × 3.8) ÷ 2

= 13.3 square units

Now, let's move on to the rectangle. The area of a rectangle can be calculated by multiplying its length and width. In your case, the width of the rectangle is 7 units and the height is 8.2 units. Therefore, the area of the rectangle can be calculated as:

Area of rectangle = Length × Width

= 8.2 × 7

= 57.4 square units

To know more about area here

https://brainly.com/question/14994710

#SPJ1

A drawer is filled with 2 white shirts, 5 black shirts, and 3 gray shirts. One shirt is
chosen at random from the drawer. Find the probability that it is not a white shirt.

Answers

Okay, let's break this down step-by-step:

* There are 2 white shirts, 5 black shirts, and 3 gray shirts in the drawer.

* That's a total of 2 + 5 + 3 = 10 shirts.

* We want to find the probability that the chosen shirt is NOT white.

* So there are 5 + 3 = 8 shirts that are NOT white.

* Probability = (Number of favorable outcomes) / (Total possible outcomes)

* So in this case, Probability = 8/10 = 4/5

Therefore, the probability that the chosen shirt is NOT white is 4/5.

8/10. Add up the number of shirts and there is 10 shirts total. There are two white shirts so you would subtract 2 from 10 to get the non white shirts.

9. Maria is twice the age of Jonas, who is
twice the age of Franklin. Franklin is 2. yr
less than half Maria's age. How old are
Maria, Jonas, and Franklin?

Answers

Answer:  Maria is 12 years old, Jonas is 6 years old, and Franklin is 3 years old.

Step-by-step explanation:  Let's start by assigning variables to represent the ages of Maria, Jonas, and Franklin.

Let's use the variable "M" to represent Maria's age.

Let's use the variable "J" to represent Jonas's age.

Let's use the variable "F" to represent Franklin's age.

From the problem statement, we know that:

Maria is twice the age of Jonas: M = 2J

Jonas is twice the age of Franklin: J = 2F

Franklin is 2 years less than half of Maria's age: F = 0.5M - 2

We can use these equations to solve for the ages of Maria, Jonas, and Franklin.

First, we can substitute J = 2F into the equation M = 2J to get M = 2(2F) = 4F.

Next, we can substitute this expression for M into the equation F = 0.5M - 2 to get F = 0.5(4F) - 2, which simplifies to 2F = 6 and therefore F = 3.

Now that we know Franklin's age, we can use the equation J = 2F to find Jonas's age: J = 2(3) = 6.

Finally, we can use the equation M = 2J to find Maria's age: M = 2(6) = 12.

Therefore, Maria is 12 years old, Jonas is 6 years old, and Franklin is 3 years old.

Cylinder 1 contains a 1.25 M stock solution of Cu(NO3)2. What volume of stock is needed to prepare 20.0 mL of 0.0750 M Cu(NO3)2 solution shown in Cylinder 2?

Answers

The Volume of stock solution needed = 1 mL

How to solve

Molarity of stock solution (M1) = 1.50 M

The volume of stock solution needed (V1) = to be calculated

Molarity of diluted solution (M2) = 0.0750 M

The volume of diluted solution (V2) = 20 mL

M1V1 = M2V2

Volume of stock solution (V1) = M2V2 / M1 = (0.075 M x 20 mL) / (1.5 M) = 1 mL

So; the Volume of stock solution needed = 1 mL


Read more about Volume here:

https://brainly.com/question/27710307

#SPJ1

you roll a 6 sided die; what is P(4 or less than 3)

Answers

Answer:

1/2

Step-by-step explanation:

The probablility of any number on a die is 1/6.

So the numbers 4, 2, and 1 each have a probability of 1/6 meaning that each have a total probability of: 1/2. 3 is not accounted for due to our restriction.

Calculate the MAY raw materials purchases in dollars. (SEE IMAGE FOR DETAILS) financial accounting
Rensing Ltd estimates sales for the second quarter of 2020 will be as follows. April: 2,520 May: 2,440 June: 2,390

target ending inventory finished products. March 31: 2,010 April 30: 2,280 May 31: 2,170 June 30: 2,330

Answers

The May raw materials purchases for May in Rensing Ltd., in dollars terms, is $32,620.

How the raw materials purchases are determined:

The cost of raw materials purchased in May is determined by computing the required production units and multiplying the result by 2 units and the unit raw material cost.

Purchase Budget:

                                     April     May      June

Sales                           2,520   2,440   2,390

Ending inventory       2,280    2,170    2,330

Goods available for

 sale                          4,800    4,610    4,720

Beginning inventory              2,280    2,170

Production units                     2,330

Raw materials purchases      4,660 (2,330 x 2)

Raw materials price per unit = $7

Total purchases of Raw Materials for May = $32,620 (4,660 x $7)

Thus, we can conclude that in May Rensing Ltd. purchased raw materials worth $32,620.

Learn more about raw materials purchase costs at https://brainly.com/question/30311987.

#SPJ1

IF YOU CAN ANSWER THIS CORRECT WITH A Good explanation I'll give 5 stars, a thanks and brainly (also your very smart)

Rebecca is x years old.Mary is 8 years older than rebecca. Jill is three times older than mary. The sum of their ages is 67.
A) form an expression in terms of x

Answers

Answer:

A) 5x+32=67

Rebecca is 7, Mary is 15, and Jill is 45

Step-by-step explanation:

Rebecca is x years old.

If Mary is 8 years older than Rebecca, Mary's age is 8 more than x.

We can write Mary's age as:

x+8

Jill is three times older than Mary.

This means that Jill's age is equal to three times x+8.

We can write Jill's age as:

3(x+8)

Use the distributive property.

3(x+8)=

3x+24

So, Jill's age (in terms of x) is 3x+24.

The sum of their ages is 67, so if we add all of their ages, we will get 67.

x+(x+8)+(3x+24)=67=

5x+32=67

Not sure if you want this solved, but here it is:

5x+32=67=

5x=35=

x=7

Let's find Mary's age.

x+8=

7+8=

15.

Now, let's find Jill's age.

3x+24=

3(7)+24=

21+24=

45.

So, Rebecca is 7, Mary is 15, and Jill is 45.

What is the equation of the line that represents the horizontal asymptote of the function
f(x) = 3000 (1 +0.09)^x-2 +4?

Answers

Answer:   y=4

Step-by-step explanation:

The Parent function [tex]y=a^{x}[/tex]  has a horizontal asymtote at y=0

because the function approaches 0 but never touches it no matter how small the number you input.  See image.  Asymtotes are like a boundary that is not passed

Your curve has been shifted up 4 so y=4

See image

Extra info:   y-intercept = 3000

shifted right 2

The scale drawing car length is 3cm. If the scale is 1cm:4ft, what is the actual car length?

Answers

Answer: The actual car length is 12ft.

Step-by-step explanation:

Actual car length = 3cm x 4ft/cm = 12ft

Select the statement that shows equivalent measurements.

4.5 meters = 0.0045 kilometers
4.5 meters = 0.045 centimeters
4.5 meters = 0.45 decimeters
4.5 meters = 45 decameters

Answers

The statement that shows equivalent measurements is "4.5 meters = 0.0045 kilometers".

How to solve the problem?

To convert meters to kilometers, we need to divide by 1000, since there are 1000 meters in a kilometer. Therefore, 4.5 meters is equal to 4.5/1000 = 0.0045 kilometers.

The other statements are incorrect:

4.5 meters is not equal to 0.045 centimeters, since there are 100 centimeters in a meter, so 4.5 meters is equal to 450 centimeters.

4.5 meters is not equal to 0.45 decimeters, since there are 10 decimeters in a meter, so 4.5 meters is equal to 45 decimeters.

4.5 meters is not equal to 45 decameters, since there are 10 meters in a decameter, so 4.5 meters is equal to 0.45 decameters.

It is important to be able to convert between different units of measurement in order to make accurate comparisons and calculations. In this case, the correct conversion factor was used to convert meters to kilometers, resulting in an equivalent measurement.

To know more about Measurement visit :-

https://brainly.com/question/27233632

#SPJ1

Two different rectangles are joined together to make a compound shape. Shape A has a length of (x + 3) and a width of (x + 2). Shape B has a length of (x + 6) and a width of (x-2). All measurements are in centimetres. (x+3) Shape A Shape B (x+6) (x + 2) NOT TO SCALE (x-2) Find an expression for the area of the compound shape in cm². Give your answer in the form ax² + bx + c.​

Answers

The expression for the area of the compound shape in cm² is 2x^2 + 11x - 6.

What is the expression for the area?

To find the expression for the area of the compound shape, we need to first calculate the individual areas of Shape A and Shape B, and then add them together.

The area of Shape A is given by multiplying its length and width:

Area of Shape A = (x + 3) * (x + 2)

The area of Shape B is given by multiplying its length and width:

Area of Shape B = (x + 6) * (x - 2)

Now, we can add the two areas together to get the expression for the area of the compound shape:

Area of compound shape = Area of Shape A + Area of Shape B

= (x + 3) * (x + 2) + (x + 6) * (x - 2)

Expanding the above expression, we get:

= x^2 + 2x + 3x + 6 + x^2 + 6x - 12

= 2x^2 + 11x - 6

Learn more about expressions here: https://brainly.com/question/723406

#SPJ1

I need help with questions 2 and 3 please.

Answers

Answer:

1.x=7 or x=-7

2.x=root of 65 or x=-root of 65

Step-by-step explanation:

I have put what I mean by root 65

A boat needs to travel North at 30km/h, a constant current of 4km/h is flowing in a north-west direction - What is the equivalent speed in still water for the boat to achieve actual speed of 30km/h ?​

Answers

The equivalent speed in still water for the boat is 30.26 km/h.

What is the equivalent speed of the boat?

The equivalent speed of the boat in still water is calculated as follows;

The boat needs to travel North at 30 km/h,

The speed of the wave = 4 km/h

The equivalent speed of the boat in still water is calculated by applying Pythagoras theorem;

v² = (4 km/h)² + (30 km/h)²

v = √ [(4 km/h)² + (30 km/h)²]

v = 30.26 km/h

Thus, the equivalent speed of the boat is calculated by applying vector addition principle.

Learn more about equivalent speed here: https://brainly.com/question/6504879

#SPJ1

Minimise : 3x+2y
Subject to: 5x+y=10
X+y=6
X+4y= 12
Find this question?

Answers

This is a linear programming problem with three constraints and two variables, where the objective is to minimize the expression 3x + 2y subject to the following constraints:

5x + y = 10

x + y = 6

x + 4y = 12

The first constraint represents a straight line in the x-y plane, the second constraint represents another straight line, and the third constraint represents yet another straight line. The feasible region is the region where all three constraints are satisfied simultaneously, which is the intersection of the three lines.

To solve this problem, you can use the method of substitution or elimination to solve for one variable in terms of the other in two of the equations, and then substitute this expression into the third equation to obtain a single equation in one variable. You can then solve for that variable, and use back-substitution to find the values of the other variable.

For example, using the first and second equations, you can solve for x in terms of y as follows:

x = 6 - y (from the second equation)

y = 10 - 5x (from the first equation)

Substituting y = 10 - 5x into the third equation, you get:

x + 4(10 - 5x) = 12

Simplifying this equation, you get:

-19x + 40 = 0

Solving for x, you get:

x = 40/19

Using x = 40/19 and the equation x + y = 6, you can solve for y as:

y = 6 - x = 6 - 40/19 = 94/19

Therefore, the minimum value of 3x + 2y subject to the given constraints is:

3(40/19) + 2(94/19) = 222/19

And the values of x and y that minimize this expression are:

x = 40/19 and y = 94/19.

To know more about elimination visit :

https://brainly.com/question/29560851

#SPJ1

This is a linear programming problem with three constraints and two variables, where the objective is to minimize the expression 3x + 2y subject to the following constraints:

5x + y = 10

x + y = 6

x + 4y = 12

The first constraint represents a straight line in the x-y plane, the second constraint represents another straight line, and the third constraint represents yet another straight line. The feasible region is the region where all three constraints are satisfied simultaneously, which is the intersection of the three lines.

To solve this problem, you can use the method of substitution or elimination to solve for one variable in terms of the other in two of the equations, and then substitute this expression into the third equation to obtain a single equation in one variable. You can then solve for that variable, and use back-substitution to find the values of the other variable.

For example, using the first and second equations, you can solve for x in terms of y as follows:

x = 6 - y (from the second equation)

y = 10 - 5x (from the first equation)

Substituting y = 10 - 5x into the third equation, you get:

x + 4(10 - 5x) = 12

Simplifying this equation, you get:

-19x + 40 = 0

Solving for x, you get:

x = 40/19

Using x = 40/19 and the equation x + y = 6, you can solve for y as:

y = 6 - x = 6 - 40/19 = 94/19

Therefore, the minimum value of 3x + 2y subject to the given constraints is:

3(40/19) + 2(94/19) = 222/19

And the values of x and y that minimize this expression are:

x = 40/19 and y = 94/19.

To know more about elimination visit :

https://brainly.com/question/29560851

#SPJ1

Other Questions
A sample of sodium azide (NaN3), a compound used in automobile air bags, was thermally decomposed, and 15.3 mL nitrogen gas was collected over water at 25C and 755 torr. Given the vapour pressure of water at 25C is 23.6 torr, how many grams of nitrogen were collected? Describe the use of the source and destination ports in both UDP or TCP packets in a request for a service 3. Describe the use of the source and destination ports in both UDP or TCP packets in a response back to the client. What would be the major product of the following reaction? i) NaBH4 ii) NaH, Et20 A O=S=0 OCH2CH3 1) CH3CH2OCH(CH3)CH2CH2CH2CH3 II) (CH3CH20)2CHCHOHCH2CH2CH3 III) (CH3CH2)2CHOHCH2CH2CHOHCH3 IV) CH3OCH(C2H5)CH2CH2CH2CH3 V CH3CH2CH(OCH3)CH2CH2CHOHCH3 (I NEED THIS RIGHT NOW!! PLEASE GIVE EXPLANATION!!) Millie and her brother, Jack, sold candy baes for the band fund-raiser. Millie sold three times as many candy bars as Jack. If Jack sold 30 candy bars, which equation and solution can be used to represent y, the number of candy bars Millie sold?A. 3y = 30; y = 10B. 30 = y/3; y = 103C. 30 = y/3; y = 90D. 3y = 30; y = 90 What are the risks and advantages of praising people publicly, such as in news headlines, for making good moral choices? Use evidence from the text to support your answer. true or false the smallest kinetic energy that an electron in a box (an infinite well) can have is zero. A client is admitted with a tentative diagnosis of congestive heart failure (CHF). Which assessment finding, consistent with this diagnosis, would the nurse expect?Inspiratory cracklesCyanosisChest painHeart murmur Identify the law illustrated by the following: 4bracket(3x-7) is equivalent to 12x-28. Consider the joint PDF of two random variables X, Y given by fx,y (x, y) = C, where 0 need the answers for the proofs both 13 and 14 Talisa plans a 36-foot deep pond. While digging, she hits rock 30 feet down. How can Talisa modify the radius to maintain the original volume of the pond?Talisa should make the radius ___ ft pls help bro ima fail 1. For parts of the free response question that require calculations, clearly show the method used and the steps involved in arriving at your answers. You must show your work to receive credit for your answer. Examples and equations may be included in your answers where appropriate. Answer the following questions related to CO2. 30-C=0 0=c=0 Diagram X Diagram z (a) Two possible Lewis electron-dot diagrams for CO2 are shown above. Explain in terms of formal charges why diagram 2 is the better diagram. (b) Identify the hybridization of the valence orbitals of the Catom in the CO2 molecule represented in diagram 2 (c) A 0.1931 mol sample of dry ice, CO2(s), is added to an empty balloon. After the balloon is sealed, the CO2(8) sublimes and the CO2(g) in the balloon eventually reaches a temperature of 21.0C and pressure of 0.998 atm. The physical change is represented by the following equation. CO2(8) + CO2(9) AHyublimation =? (1) What is the sign (positive or negative) of the enthalpy change for the process of sublimation? Justify your answer. (11) List all the numerical values of the quantities, with appropriate units, that are needed to calculate the volume of the balloon. (iii) Calculate the final volume, in liters, of the balloon. calculate the concentration of c6h5nh3 c6h5nh3 and clcl in a 0.215 mm c6h5nh3clc6h5nh3cl solution. Determine the drag coefficient for a smooth golf ball at standard sea-level conditions with a velocity of100mph, noting it has a diameter of1.68in. Make use of Figure 4-34 from the text. Video observations on the deceleration on a dimpled golf ball provide an estimated drag force of0.080lb, at the same conditions noted above. Determine the drag coefficient for the dimpled golf ball and use Figure4.34to make a statement on the condition of the boundary layer between the two surface conditions and the effective Reynolds number. A factory makes two products, puzzle cubes and puzzle spheres. Unfortunately, 1.5% of the cubes are defective and 2% of the spheres are defective. They make four times as many cubes as spheres. What percent of their products are defective? Suppose that you are told that the Taylor series of f(x) = x^4ex^3 about x = 0 is x^4 + x^7 + x^10/2! + x^13/3! + x^16/4! + ... Find each of the following: d/dx (x^4 e^x^3)|_x=0 = d^10/dx^10(x^4 e^x^3)|_x=0 = show that if n is a power of 2, say , then i=0klg(n2i)=(lg2n) TJs offers a $1,000 face value, zero coupon bond with a yield to maturity of 11.3 percent, given annual compounding. The bond matures in 16 years. What is the current price?A. $178.78B. $180.33C. $188.36D. $190.09E. $192.18 Draw all of the expected products for each of the following solvolysis reactions: Get help answering Molecular Drawing questions. X Your answer is incorrect. Try again. (a) Br ? E1OH heat Edit Get help answering Molecular Drawing questions. X Your answer is incorrect. Try again. (b) ? H heat CI (c) Br ? heat Edit Get help answering Molecular Drawing questions. Your answer is incorrect. Try again. (d) CI ? heat Edit