Name
Date
Unit 2 Mid-Unit Assessment continued
Form A
6
Ben has 5 comic books. His cousin Kurt has 6 times as many comic books
as Ben has.
Part A
Draw and label a bar model to show the number of comic books
each boy has.

Answers

Answer 1

Answer:

das

Step-by-step explanation:

adsasc


Related Questions

Dan spent 0.125 of his money in snacks, 1/4 on travelling and saved the
rest. If he saved $65, how much money did he have at first?​

Answers

Answer:

89.38

Step-by-step explanation:

65 times 0.125 = 8.125

65 times 0.25 = 16.25

16.25 plus 8.125 plus 65 = 89.38 dollars

67-2x+89/2+7-8x=0
help me please​

Answers

Answer:

x = 11.85

Step-by-step explanation:

[tex]67 - 2x + \frac{89}{2} + 7 -8x = 0\\\\67 + \frac{89}{2}+7 = 8x + 2x\\\\\frac{134 + 89 +14}{2} = 10x\\\\10x = 118.5\\\\x = 11.85[/tex]

Answer:

[tex]x = 11 \frac{17}{20}[/tex] or [tex]\frac{237}{20}[/tex]

Step-by-step explanation:

Isolate the variable by dividing each side by factors that don't contain the variable.

Q.6.
Lisa wanted to paint her ugly brown flower box
red. Using the given dimensions, how many square
inches will she have to paint? (remove the top
base)

Answers

Answer:

10x22x8

Step-by-step explanation:

1760 is the answer

PLS HELP ASAP!! need the answer

Answers

Answer:

60 degrees

Step-by-step explanation:

Omar, Amare, and Jack paid a total of $68.25 for dinner and tickets to a concert. The concert
tickets cost $9.75 each. If the 3 friends split the dinner bill equally, how much did each friend
spend on dinner?

Answers

Answer:

32.5

Step-by-step explanation:

I I divided ot then added it together

For the data in the table, does y vary directly with x? If it does, write an equation for the direct variation.

TABLE

x y
-------
2 10
4 24
6 36​

Answers

Answer:

y does not vary directly with x

Step-by-step explanation:

The equation for direct variation is

y = kx ← k is the constant of variation

If k is constant for all ordered pairs in the table then direct variation.

k = [tex]\frac{y}{x}[/tex]

(2, 10 ) → k = [tex]\frac{10}{2}[/tex] = 5

(4, 24 ) → k = [tex]\frac{24}{4}[/tex] = 6

(6, 36 ) → k = [tex]\frac{36}{6}[/tex] = 6

Since k is not constant for all pairs then y does not vary directly with x

What is the range of y= sec-'(x)? PreCal, send help please!!

Answers

Given:

The function is:

[tex]y=\sec^{-1}(x)[/tex]

To find:

The range of the given function.

Solution:

We have,

[tex]y=\sec^{-1}(x)[/tex]

The range of secant inverse function is:

[tex]Range=\{y|0\leq y\leq \pi , y\neq \dfrac{\pi}{2}\}[/tex]

The range of the given function in interval notation is:

[tex]Range=\left[0,\dfrac{\pi}{2}\right)\text{ and }\left( \dfrac{\pi}{2}, \pi\right ][/tex]

Therefore, the correct option is C.

Can someone help me please?

Answers

the answer is 0.62

62/100 = 0.62

Answer:

0.62

Step-by-step explanation:

the 62 is the number you're mainly working with and the 100 represents the place value! so the 100 means you need to place the top number in the hundredths place (0.62)

Hope this helps! Good luck with your math work!

Hi plz help, if you can ill mark you 5 starz! :)

Answers

Answer:

12 kg, 1200 mm, 1200 ml (twice), 12 m, and 120 mm

Answer:

12,000 is 12

120 is 120

1.2 L is 1200

1200 is 120

0.12 is 12


PLS ANSWER RN

What is the area of AJKL?

Answers

Answer:

8.5

Step-by-step explanation:

slope of the line that contains KL

(y2 - y1)/(x2-x1)

(0-1)/(7-3)

m = -1/4

slope of the line that contains JK

(5-1)/(4-3)

m = 4

the linea are perpendicular so triangle is right

area = (leg1 x leg2)/2

KL = [tex]\sqrt{(7-3)^2 + (0-1)^2} = \sqrt{16 + 1} = \sqrt{17}[/tex]

KJ = [tex]\sqrt{(4-3)^2 + (5-1)^2}= \sqrt{1 + 16} = \sqrt{17}[/tex]

area = (√17)^2/2 = 17/2 = 8.5

8.5



….hope this helps!

Find the equation (in terms of x ) of the line through the points (-3,4) and (1,-8)

Answers

Answer:

A(-3,4) B(1,-8)

y-y1/x-x1 =y2-y1/x2-x1

y-4/x--3 = -8-4/1--3

y-4/x+3 = -12/1+3

y-4/x+3 =-12/4

y-4/x+3 = -3

y-4 = -3(x+3)

y-4=-3x-9

y+3x +9-4=

y+3x+5=0

Answer:

y = -3x - 5

Step-by-step explanation:

-3, 4 and 1, -8

1 - -3 = 4

-8 - 4 = -12

[tex]\frac{-12}{4}[/tex] = [tex]\frac{-3}{1}[/tex] = -3

gradient/slope = -3

now substituting in the point -3, 4 to find the y intercept:

4= -3 x -3 + c

4 = 9 + c

-5 = c

y intercept = -5

equation is y = -3x - 5

Kirenna's boss, Tanae, believes that women are not capable of making top-level decisions. Kireena's decisions are often sidelined by those of Tanae. When Kirenna confronts Tanae, he terminates her employment. Which of the following is the most appropriate suit that will help Kirenna?

a. a retaliation lawsuit
b. a forgery lawsuit
c. a reverse discrimination suit
d. a public policy violation lawsuit
e. a civil right infringement lawsuit

Answers

Answer:

e. a civil right infringement lawsuit

Step-by-step explanation:

A civil right infringement lawsuit is a lawsuit filed by an offender whose civil rights have been violated by others. Civil rights are those rights of the citizens that is guaranteed by the Constitution of the United States to its people. They are right to equality, right to freedom, right to employment and all those rights that is included in the Bill of Rights of the US constitution.

So, when Kirenna was terminated by her boss, Tanae on the grounds on the discrimination of gender, Kirenna can file a civil right infringement lawsuit against her boss, Tanae.

What's the answer to this? I thought it was -138 apparently it's not? :(

Answers

The answer is 78 because if you substitute with the x=3 it changes the outcome of the answer:)

The price of an item has been reduced by 70% the original price was $20 what is the price of the item now

Answers

Just find 70 % of $20 and that’s the price.

20 x 0.7 = 14
20 - 14 = 6

The price of the item is $6

A silo contains 60,000 pounds of grain.

How many tons are in 60,000 pounds?

Answers

Answer:

30

Step-by-step explanation:

Answer:

30

Step-by-step explanation:

I took the quiz, I hope this helps!

Encuentre el volumen de 35 kg de oro

Answers

Speak in English so that I can understand

The expression 4x* represents 144​

Answers

Answer:

x=36

Step-by-step explanation:

because 4x36=144

Answer:

4x = 144

4 • 36 = 144

The answer to the equation is 36

A survey of 35 people was conducted to compare their self-reported height to their actual height. The difference between reported height and actual height was calculated. You're testing the claim that the mean difference is greater than 0.7. From the sample, the mean difference was 0.95, with a standard deviation of 0.44. Calculate the test statistic, rounded to two decimal places

Answers

Answer:

The test statistic is t = 3.36.

Step-by-step explanation:

You're testing the claim that the mean difference is greater than 0.7.

At the null hypothesis, we test if it is 0.7 or less, that is:

[tex]H_0: \mu \leq 0.7[/tex]

At the alternate hypothesis, we test if it is greater than 0.7, that is:

[tex]H_1: \mu > 0.7[/tex]

The test statistic is:

[tex]t = \frac{X - \mu}{\frac{s}{\sqrt{n}}}[/tex]

In which X is the sample mean, [tex]\mu[/tex] is the value tested at the null hypothesis, s is the standard deviation and n is the size of the sample.

0.7 is tested at the null hypothesis:

This means that [tex]\mu = 0.7[/tex]

Survey of 35 people. From the sample, the mean difference was 0.95, with a standard deviation of 0.44.

This means that [tex]n = 35, X = 0.95, s = 0.44[/tex]

Calculate the test statistic

[tex]t = \frac{X - \mu}{\frac{s}{\sqrt{n}}}[/tex]

[tex]t = \frac{0.95 - 0.7}{\frac{0.44}{\sqrt{35}}}[/tex]

[tex]t = 3.36[/tex]

The test statistic is t = 3.36.

the given tables shows the number of shirts and pants different people own. what number correctly completes the table so that each person has the same ratio of pants to shirts​

Answers

Answer:

He needs 15 shirts

Step-by-step explanation:

We can use a ratio to solve

4 pants             6 pants

--------------- = -------------

10 shirts            x shirts

Using cross products

4x = 10 *6

4x = 60

Divide each side by 4

4x/4 = 60/4

x = 15

He needs 15 shirts

Match each tool with how we used it in class

Answers

Answer:

1 - b

2 - a

3 - c

Step-by-step explanation:

1. B
2.a
3.c
Hope this helps

PLEASE HELP IM BEING TIMED

Answers

Answer:

1

Step-by-step explanation:

Any number to the 0 power is equal to 1.

Hope that this helps!

Answer:

1 is correct

Any number that is raised to the power of 0 is 1, and any number that’s raised to the power of 1 is itself

Jake studied
z
hours for a big test. Julie studied half as long.

Write an algebraic expression for long Julie studied.

Answers

Answer:

(1/2)z

Step-by-step explanation:

I only need help on number six

Answers

Answer:

288 inches = 8 yards

Step-by-step explanation:

Answer:

[tex]6 . \: 8 \: yards \: = \: 288 \: inches[/tex]

[tex]8. \: 18 \: feets \: = \: 216 \: inches[/tex]

[tex]10. \: \frac{1}{3} \: yards \: = 12 \: inches[/tex]

Step-by-step explanation:

6. 1 yard = 36 inches

8 yards = 36 × 8

= 288

8. 1 feet = 12 inches

18 feets = 12 × 18

= 216 inches

10. 1/3 into decimal = 0.33333333333

1/3 yards = 0.33333333333 × 36

= 12 inches

Hope it is helpful....

Find the volume of the cone. Round your answer to the nearest hundredth.

Answers

Answer:

I believe the answer is 1.36

What is the area of the figure? NO LINKS!!

Answers

Answer:

Area of the figure is 88 square inches

equations equivalent to x/4+1/3=5/6

Answers

If I rewrite this it would be
3x/12+4/12=10/12
3x=6
So your answer would be
2/4+1/3=5/6
Or
1/2+1/3=5/6
X=2

Write the inverse function for the function, ƒ(x) =1/2 x + 4. Then, find the value of ƒ -1(4). Type your answers in the box.

ƒ -1(x) =

ƒ -1(4) =

Answers

Answer:

0

Step-by-step explanation:

Given that f(x) = 1/2x + 4

Let y = f(x)

y = 1/2 x + 4

Replace y with x

x = 1/2 y + 4

Make y the subject of the formula

1/2y = x - 4

y = 2(x-4)

If x = 3

y = 2(4-4)

y = 2(0)

y = 0

Hence ƒ -1(4) is 0

if you found any words about mathematics, tell me please

Answers

Answer:

geometry

Step-by-step explanation:

left side of paper

△JKL has vertices at J(−2, 4), K(1, 6), and L(4, 4). Determine whether △JKL is a right triangle

Answers

Answer:

Not a right triangle

Obtuse isosceles triangle.

Sides: J = 3.606   K = 6   L = 3.606

Step-by-step explanation:

hope helps you

have a nice day

PLEASE HELP



what's x
cos(x+pi)-sin(x-pi)=0

please show work​

Answers

sin(x+pi)=-sin(x)=sin(-x)=cos(pi/2)

cos (x+pi)=-cos(x)

So according to the question:

cos(pi/2 +x)=cos(x)

Using the solution of cos, obtain:

(pi/2) + x = 2pi +- (x)

case#1: (pi/2) + x = 2pi + (x)

But here, the value of x is canceled, just

case#2: (pi/2) + x = 2pi - (x)

answer------------>>>>>>>>> x=pi-pi/4

Other Questions
Please answer the question posted in the attached image Write a function definition for a function which takes one parameter and returns twice that parameter According to the map above, about how much precipitation can Stillwater expect to receive each year? A. Less than 24 in. B. 24 32 in. C. 32 40 in. D. More than 40 in. In ______ reproduction, genetically identical offspring are produced, while in ______ reproduction, offspring are genetically different from each other. Multiple choice question. asexual; sexual When you test starch with Barfoeds reagent, what would be the answer, positive or negative? A person who enters a room and screams bomb! Just to see the reaction of the people in the room is protected under provisions in the bill of rights.. WHY????WHAT AMENDMENT DOES THIS SCENARIO DEAL WITH: Goats and sheep belong to the same family but different genera. While they often live together in the same pastures, the hybrid offspring that are occasionally produced between the two species rarely survive. When such a hybrid does survive, it is usually sterile. Which of the following best explains the mechanism that maintains reproductive isolation between goats and sheep? a. Gene flow is prevented because the two species belong to different trophic levels and therefore do not share a food source. b. Habitat isolation creates a prezygotic barrier between the two species. c. The males of one species and the females of the other species are fertile at different times. d. The two species have a different number of chromosomes, resulting in a postzygotic barrier. What is the vertex of the absolute value function below?2854 3 21+54-12-2(-3,-2)(-3.2)0 (2-3)123) There is no losing. There is only winning and learning. Think of a time in your life when this quotation was true for you. Tell the story of what happened and what you learned in the process.7 sentences at least PLEASE HURRY!!! How did World War 2 have a bigger impact on Kentucky than World War 1? (I need a paragraph) I will mark you branliest please! Who is good at French? :) Do not use the translator. 23. Rewrite the following sentence in the futur proche using aller.Je vais au muse.24. Compose a complete sentence using the following words. Use the pass compos and remember to conjugate the verb.vous / se lever / trs tt25. Rewrite the following sentence in the negative.Nous nous sommes brosses.26. Rewrite the following sentence in the pass compos.Vous devez ranger la cuisine.27. Rewrite the following sentence in the imperfect.Ils voient beaucoup de beaut.28. Fill in the blank in the following sentence with the superlative phrase that will make the sentence mean "China is the largest country."C'est la Chine29. Rewrite the following sentence in the future tense.Nous commenons nos devoirs.30. Rewrite the following question, replacing the direct object with a direct object pronoun.Vous voulez parler mon patron?31. What is the mettre expression for se fcher? Or rewrite the following sentence using the expression containing the verb mettre.Je me suis fch.42. Rewrite the following sentence, replacing the direct object and the indirect object with direct object and indirect object pronouns.J'offre une pizza mes cousines. The type of winds that blow from 300 N or S latitude in a westerly direction are called the?? who knows how to problem solve this this problem? How many bottles of water will make you lose weight, but won't diagnose you with hyponatremia? What is the length of AB?? Examine the chart shown below.genotype phenotypeBB black furBbblack furbbbrown furWhat does the phenotype represent?OA.the physical appearance or expression of an organism's allelesB.the combination of alleles that an organism possessesOC.only the recessive form of a geneODthe crossing-over of genetic traits Problem Lines AAA, BBB, and CCC show proportional relationships. Which line has a constant of proportionality between yyy and xxx of 333? Choose 1 answer: Describe the kind of transport the paramecium uses to remove water from its cytoplasm. (1 point) b. Explain the relationship between the contractile vacuole activity and the environmental salt concentration. (1 point) c. Predict what would occur in the paramecium if a biological toxin blocked the activity of the contractile vacuole. (1 point) d. Justify your prediction in part C. (1 point) How many grams of ammonium fluoride, , must be dissolved to prepare 300. mL of a 0.234 M aqueous solution of the salt (100 POINTS!!!!!!) PLEASE DO NOT ANSWER THE QUESTION, JUST EXPLAIN HOW I CAN GET THE ANSWER