Answer:
Well lithium is a metal and chlorine is a nonmetal. Therefore this is most likely going to be ionic
Write the complete balanced equation for Manganese & sulfuric acid --> Manganese (II) sulfate & water & sulfur dioxide
no spaces
no subscripts
no 1's for coefficients
WILL GIVE BRAINLIEST!
Answer:
I kinda forgot. I'm sorry if I didn't answer your question.
Explanation:
The boiling temperature of water is directly related to the atmospheric pressure. At sea level, the atmospheric pressure is 760 torr whereas the boiling temperature is 100equationC. If the atmospheric pressure is lower than 760 torr, then the boiling temperature will be less than 100equationC. If the atmospheric pressure is higher than 760 torr, then you would expect the boiling temperature to be higher than 100equationC. At higher elevations, the atmospheric pressure is lower resulting in a lower boiling temperature. For example: Denver, CO experiences a boiling temperature at ~ 94equationC. If you were conducting an experiment that involved boiling water, what would you expect the boiling temperature to be if the atmospheric pressure was 790 torr
Answer:
If the atmospheric pressure is lower than 760 torr, then the boiling temperature will be less than 100equationC.
B. 97.7°C
Explanation:
The question mentions the fact that temperature and pressure are directly proportional. This means that if one quantity is increasing the other increases simultaneously and vice versa.
Hence, if the atmospheric pressure is lower than 760 torr, then the boiling temperature will be less than 100equationC.
From;
PαT
P=kT
Hence
P/T = k
P1/T1 = P2/T2
P1T2 = P2T1
P1 = 760 torr
T1 = 94°C
T2 = ?
P2 = 790 torr
T2 = P2T1/P1
T2 = 790 * 94/760
T2 = 97.7°C
what are the Common compounds of niobium in which it is found
(include common names and their chemical formulas)
plssss help
Explanation:
Common Compounds of Niobium Nb
[Nb+3, Nb+5]
Compound NameFormulaMolar Mass
Niobium(III) OxideNb2O3233.811
Niobium(III) SulfateNb2(SO4)3474.0006
Niobium(V) PhosphateNb3(PO4)5753.576
Niobium(V) BromideNbBr5492.4264
Niobium(V) PentoxideNb2O5265.8098
Niobium OxychlorideNbOCl3215.2648
Niobium(V) IodideNbI5727.4287
Niobium(V) PentachlorideNbCl5270.1714
Niobium(V) ThiocyanateNb(SCN)5383.3184
Niobium(III) ChlorideNbCl3199.2654
Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259
Niobium NitrideNbN106.9131
Niobium(III) DichromateNb2(Cr2O7)3833.77676
Niobium HydroxideNb(OH)3143.9284
Niobium(V) PerchlorateNb(ClO4)5590.15938
Niobium(V) HypochloriteNb(ClO)5350.16838
Niobium(III) HypochloriteNb(ClO)3247.26358
Niobium(V) CarbonateNb2(CO3)5485.85726
Niobium(III) TartrateNb2(C4H4O6)3630.02564
Niobium(III) ChromateNb2(CrO4)3533.79386
Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356
What is the half life of this element?
A. 80 days B. 40 days C. 5 days D. 10 days
Answer:
c. 5days
Explanation:
there is no question but if it's a graph
the answer is 5days
A 25.0 mL sample of HCI reacted with 20.0 mL of 2.00 M NaOH. What is the molarity of the HCI?
HCl(aq) + NaOH(aq) —> NaCl(aq) + H2O(l)
really need help!
Answer:
Molarity of HCl = 1.6M
Explanation:
The chemical reaction equation is;
HCl(aq) + NaOH(aq) —> NaCl(aq) + H2O(l)
Now, molarity = number of moles/volume
Thus, for NaOH, we have;
Number of moles = molarity × volume = 2M × (20/1000) L
Number of moles = 0.04 moles
Using the coefficients in the chemical equation above, we can find the corresponding number of moles for HCl.
Number of moles of HCl = 0.04 moles NaOH × (1 mole of HCl/1 mole of HCl) = 0.04 moles of HCl
Thus;
Molarity of HCl = 0.04/(25/1000)
Molarity of HCl = 1.6M
What do greenhouse gases (CO2) do to the atmosphere?
Answer:
they causes climate change by trapping heat and also they contribute to respiratory diseases from smog and air pollution
Answer:
They add C02 to our atmosphere which can give plants and soils more CO2. It can also make our earths temperature change a ton!
Explanation:
Greenhouse gases produce an increase in the average surface temperature of the earth over time.
Are the following equations balanced or unbalanced?
1. SnO2 + 2H2 → Sn + 2 H2O
2. 4NH3 + 5O2 → 4NO + 6H2O
3. 2B2Br6 + 5HNO3 2 B(NO3)3 + HBr
4. 2KNO3 + 1H2CO3 → 1K2CO3 + 2HNO3
Based on Reference Table F, describe the solubility of zinc sulfide in water.
Answer:
negligible
Explanation:
negligible meaning its not very soluble in water at all
(wikipedia)
1. What is the symbol for atomic mass? What are the units of atomic mass in terms of atoms? 2. What is the symbol for molar mass? What are the units of molar mass? 3. What is the atomic mass of iron, with units? 4. What is the molar mass of iron, with units? 5. What is formula mass? What are the units of formula mass? 6. What is the formula mass of sodium bicarbonate, with units? 7. What is the molar mass of sodium bicarbonate with units? 8. What is the molar mass of water? 9. What is the molar mass of ammonia, NH3? 10. What is the molar mass of lithium oxide? 11. What is the molar mass magnesium bicarbonate? 12. What is the molar mass of cobalt(III) carbonate?
i am NOT gonna read all of that
What is the volume of a balloon that contains 3.7 moles of helium at 75°C
and 5.1 atm?
Answer: your question is easy 21 L
By using ideal gas law the amount of volume will be 21 L.
What is ideal gas law?
The general gas equation, commonly known as the ideal gas law, is the state equation of a hypothetical ideal gas.
Calculation of volume by using ideal gas law.
Given data:
P = 5.1 atm
n = 3.7 moles
T = 75°C (273 + 75) = 348 K
V = ?
Put the given data in ideal gas law.
PV = nRT
V = nRT / P
V = 3.7 × 8.31 × 348 / 5.1
V = 2098
V = 21 L
Therefore, By using ideal gas law the amount of volume will be 21 L.
To know more about ideal gas law.
https://brainly.com/question/4147359
#SPJ2
How many grams is 2.393 x 10^24 atoms of O?
70.45 g O
140.9 g O
63.58 mole O
63.58 g O
Answer:
63.58 g O
Explanation:
To calculate the mass of O atoms, the number of moles of O atoms are needed and can be calculated as follows:
n (no. of moles) = nA ÷ 6.02 × 10^23
n = 2.393 x 10^24 ÷ 6.02 × 10^23
n = 0.398 × 10^ (24-23)
n = 0.398 × 10^1
n = 3.98moles.
To calculate the mass of Oxygen, we use the following formula:
moles = mass/molar mass
Molar mass of O = 16.
3.98 = m/16
m = 3.98 × 16
m = 63.68grams of Oxygen.
Answer:
Solution given:
[tex]1 mole \:of O=6.023×10^{23} atoms[/tex]
1 mole of O =16g
we have
[tex] 6.023×10^{23} atoms\: of O=16g[/tex]
now
[tex] 2.393 × 10^{24} atoms\: of \:O\\=16/6.023×10^{23}*2.393 x 10^{24}g\\=63.57g[/tex]
63.57g is a required mass of O.
what is the formula for water
Answer:
H2O
Explanation:
EASIEST FORMULA ON EARTH
Use words from the box to complete the sentences.
fungi pathogen poison vaccine virus
(a) A bacteria that can cause a disease is an example of a..................................
(b) An obligate parasite that must inhabit a host cell to reproduce is a ...................................
Answer:
a) pathogen
b) virus
Explanation:
pathogens are harmful bacteria
viruses depend on the host to survive
can someone pleaze help me
Answer:
I think its the last one
Explanation:
Super sorry if its incorrect.
How do i calculate speed and find the direction of a moving object
Calculate the pH for a 1.0 x 10-5 M solution of OH at 25°C.
pH = -log[H*), pOH = -log[OH-]
14 = pH + POH
0 pH = 11.00
0 pH = 9.00
0 pH = 6.00
0 pH = 3.00
Answer:
ph=9.00
Explanation:
Given 1.0x10^-15M of OH at 25c
first find Poh from Poh=-log[OH]
then Poh=-log[1.0x10^-5]
from above Ph=5
then find Ph from ph+poh =pw
where pw=14
so
ph+5=14
ph=9.00
The pH for a 1.0 x 10-5 M solution of OH at 25°C is 9.
What is pH?pH is a measure of acidity and basicity of aqueous solution. The range of pH goes from 0 - 14, with 7 being neutral. pH of less than 7 indicate acidity, whereas a pH of greater than 7 indicates a base.pH is the measure of the relative amount of free hydrogen and hydroxyl ions in aqueous or other solutions.In water pH + pOH=14
pH = 14 - pOH = 14 - 5 = 9
From definition, pOH = - log₁₀ [OH⁻]
Thus pOH = -log₁₀ (1 x 10⁻⁵)
= - (-5) = 5
pH + pOH = 14
pH = 14 - pOH
= 14 - 5 = 9
pH = 9
Hence, pH = 9 is the correct answer.
To learn more about pH here
https://brainly.com/question/23051665
#SPJ2
Why would you rather have hot cocoa than lemonade on a cold day? (The lesson is called heat transfer)
Answer:
you would more than likely have hot coca.
Explanation:
Because when its cold out you don't want something cold, its common sense lol.
Of the following elements ____ can form a rare +4 ion *
a) Aluminum
b) Lead
c) Krypton
d) Uranium
Answer:
d is the answer.........
How many moles of CO2 are in 54.3 g of CO2 ?
Answer:
There is actually 1 mole in 54.3 g of CO2
ANSWER ASAP Please! How do groups and periods differ? What trend specifically occurs in either?
9. In a laboratory experiment, two groups of rats are fed two different fatty acids as their sole source of carbon for a month. The first group gets heptanoic acid (7:0), and the second gets octanoic acid (8:0). After the experiment, a striking difference is seen between the two groups. Those in the first group are healthy and have gained weight, whereas those in the second group are weak and have lost weight as a result of losing muscle mass. What is the biochemical basis for this difference
Answer:
Beta oxidation of the odd chain heptanoic acid will produce propionyl CoA, which can be converted in several steps to oxaloacetate. Oxaloacetate is the starting material for the process of gluconeogenesis (producing glucose from noncarbohydrate precursors). This gives extra glucose to the first group, so they will be healthier and gain weight. Beta oxidation of the even chain will entirely be oxidized to acetyl Co-A (one of the precursors of the TCA cycle). This will lead to a large excess of ketone bodies instead of glucose for energy, which will lead to the second group being weak and losing weight.
Explanation:
The difference is seen in having an odd chain and an even chain of fatty acids and how they are broken down and used in the body.
Question is in picture
Answer:
30
Explanation:
I believe it's 30 because half of 24 is 12 and that is its half life. And as you know it took 30 minutes to get there.
If we have 0.072 g of FeCl3 then how many moles are there?
Answer:
~0.0004
Explanation:
[tex]n=\frac{m}{M}[/tex]
n=0.072/(56+(35.5*3))=0.072/162.5~~0.004
Iron (III) nitrate (Fe(NO3)3) solution reacts with sodium hydroxide (NaOH) solution to form a
brown precipitate of iron (III) hydroxide (Fe(OH)3). Sodium nitrate (NaNO3) remains in solution as
it is a soluble compound.
Write the word equation and the balanced formula equation for this reaction.
Answer:
Fe(NO3)3 + 3 NaOH ===》Fe(OH)3 + 3 NaNO3
PLEASE Answer asap! Compare two periodic families below. You must include at least two facts about each family. You may use any description of properties or periodic trends to help you.
Answer:
The alkali metals/group 1 are recognized as a group and family of elements. These elements are metals. Sodium and potassium are examples of elements in this family. Hydrogen is not considered an alkali metal because the gas does not exhibit the typical properties of the group. The largest family of elements consists of transition metals/group 3-12/group 3a. The center of the periodic table contains the transition metals, plus the two rows below the body of the table (lanthanides and actinides) are special transition metals. Even though both are metals, transition metals have higher melting points; they have higher density; they are less reactive with water; they react and form ions with different charges, but Group 1 metals only form 1+ ions. (Hope the is helpful! You can reword it if you want...)
pick one answer please do not put any links just type the answer
Which pieces of equipment are
needed to calculate the velocity of a
falling object?
A stopwatch and balance
B speedometer and magnet
C compass and tape measure
D tape measure and stopwatch
how many atoms in 1kg of platinum
a 2.5x10^24
b 3.1x10^24
Answer:
3.1x10^24 it will be in 1 kg of platinum
Which of the following is an indication that a substance has undergone a chemical change?
A.
No new product has been formed.
B.
The color of the substance has not changed.
C.
The original constitute has not changed.
D.
The molecular structure has changed.
Answer:
D.
Hope it helps!!!!!!!!!
A football is moving upwards towards its peak after having been booted by the punter.
Answer:
draw a square with an errow pointing down
Explanation: