In the morning, Rafael notices that the Sun appears on one side of the sky. In the evening, he notices that the Sun appears to be on the other side of the sky. However, in class, Rafael learned that the Sun does not actually move across the sky from one side to another.

Why does it appear that the Sun starts the day on one side of the sky and ends the day on the other?
A.
The Sun spins.
B.
The Earth has two Suns.
C.
The Sun moves around the Earth.
D.
The Earth spins.

Answers

Answer 1

Answer: The earth spins while we also rotate around the sun the sun is well to us still when actually in reality the whole galaxy is moving but our planet spins and with it comes to night and day.

Explanation:


Related Questions

If it takes 5 hours to produce 8.0 kg of alcohol, how any days will it take to consume 1000 kg of glucose?

Answers

It takes 21.3 days

Further explanation

Given

5 hr = 8 kg Alcohol

Required

Days to consume 1000 kg of glucose

Solution

Alcoholic fermentation⇒ glucose produces ethanol and carbon dioxide,

C₆H₁₂O₆ → 2 C₂H₅OH + 2CO₂

mol ethanol :

[tex]\tt \dfrac{5000~g}{46~g/mol}=108.7~moles[/tex]

moles of glucose to produce 108.7 moles ethanol :

[tex]\tt \dfrac{1}{2}\times 108.7=54.35[/tex]

54.35 moles = 5 hours

moles of 1000 kg of glucose :

[tex]\tt \dfrac{10^6~g}{180~g/mol}=5555.5~moles[/tex]

So for 5555.5 moles, it takes :

[tex]\tt \dfrac{5555.5}{54.35}\times 5~hours=511.085~h=21.3~days[/tex]

Explain how to identify a starting position on a line.

Answers

Displacement is defined as the distance, in any direction, of an object relative to the position of another object. Physicists use the concept of a position vector as a graphical tool to visualize displacements. A position vector expresses the positionof an object from the origin of a coordinate system

Answer:

Pick a reference point on the line to be the zero position. Determine the direction and measure the distance from zero in standard units.

Explanation:

Which element, If combined with lodine, will have the greatest attraction for the lodine electrons?

C
P
B

Answers

Carbon is the element that if combined with iodine, will have the greatest attraction for the iodine electrons. So C

Which of the following is not true about one mole?

the mass of 1 mole of carbon atoms = the mass of

1 mole of boron atoms
one mole contains 6.02 x 1023 particles

the number of atoms in 1 mole of carbon = the number of atoms in 1 mole of boron

12 g of carbon equals one mole of carbon atoms

Answers

Answer:

A

Explanation:

Bc ik

The number of atoms in 1 mole of carbon = the number of atoms in 1 mole of boron is not true about one mole.

What element of one mole is false?

It is untrue to say that one mole of fluorine gas weighs more than one mole of oxygen gas. Fluorine gas has a molar mass of 38 grams per mole, whereas oxygen gas has a molar mass of 32 grams per mole, based on their relative molar masses.

A mole of a substance is equal to 6.022 × 10²³ of that substance (such as atoms, molecules, or ions). The number 6.022 × 10²³ is referred to as "Avogadro's number" or "Avogadro's constant."

Since boron has a different molar mass than carbon, the statement that there are the same number of atoms in each mole is untrue.

The ratio of the substance's mass to its molar mass is used to express the number of moles of an element.

Moles  = Mass/Molar mass

Given that the molar masses of carbon and boron differ, the statement that the number of atoms in a mole of carbon is equal to the number of atoms in a mole of boron is false.

Therefore, the correct answer is option c) the number of atoms in 1 mole of carbon = the number of atoms in 1 mole of boron.

The complete question is:

Which of the following is not true about one mole?

a) the mass of 1 mole of carbon atoms = the mass of

b) 1 mole of boron atoms

one mole contains 6.02 x 1023 particles

c) the number of atoms in 1 mole of carbon = the number of atoms in 1 mole of boron

d) 12 g of carbon equals one mole of carbon atoms

To learn more about one mole refer to:

https://brainly.com/question/28037816

#SPJ2

Which of the following has the highest mass?
O 1 liter
O 1 mole
O 1 gram
1 molecule

Answers

Liters are used to measure water and a liter is about as much as a big pop bottle. Moles measure large quantities of small entities, and grams measure small things like salt.

It’s the liter

find the percent composition of lead in lead (II) nitrate. round to 2 significant figures.​

Answers

Answer/Explanation:

62.559%

mass of an element   X 100%

mass of the compound

Scientific Notation: 3.45 x 10^5

E Notation: 3.45e5

Which statement accurately compares the properties of 1.00 mole of oxygen (O2) and 1.00 mole of
sodium (Na)? The oxygen -
O Contains more particles than sodium
O Contains less particles than sodium
O has a smaller mass than sodium.
O has a larger mass than sodium

Answers

Answer choice( 3) has smaller mass than sodium

Which chemical reaction shows photosynthesis?
A. water + carbon dioxide + sunlight → oxygen + glucose
B. carbon + oxygen-carbon dioxide
C. hydrogen + oxygen → water
D. nitrogen + hydrogen → ammonia

Answers

Answer:

A

Explanation:

Photosynthesis is reverse combustion, thus, water and carbon dioxide should be reactants. Photosynthesis also needs sunlight, so A it is.

Which of the following compounds would form a
crystal lattice?

water
sugar
paraffin wax
copper ID chloride

Answers

Answer:

Water

Explanation:

When water freezes it forms a crystal lattice shape

Copper chloride would form a crystal lattice. Therefore, option D is correct.

What is crystal lattice?

In crystallography, a crystal lattice can be described as a description of the ordered arrangement of atoms, ions, or molecules in a crystalline material. Ordered structures take place from the intrinsic nature of the particles to form symmetric that repeat along the principal directions of 3-D space in matter.

The smallest group of atoms in the material that constitutes this repeating pattern is known as the unit cell. The unit cell fully reflects the symmetry and structure of the crystal, which is built up by the repetition of the unit cell along its principal axes.

The lengths of the principal axes of the unit cell and the angles are the lattice constants called lattice parameters. The symmetry properties of the crystal are based on the concept of space groups.

The crystal structure and symmetry determine many physical properties, such as electronic band structure, cleavage, and optical transparency.

Learn more about crystal lattice, here:

https://brainly.com/question/11207173

#SPJ2

Explain in a short sentence how you can tell if a reaction is a synthesis reaction.

Answers

Answer:

In a synthesis reaction, two or more chemical species combine to form a more complex product.

Explanation:

APE X What is happening to particles of matter while a change of state is taking place?
a. They are staying at the same speed
b. They are multiplying in number
c. They are slowing down
d. They are speeding up

Answers

Answer:

a. They are staying at the same speed

Explanation:

IF CORRECT PLSPLSPLS GIVE BRAINLIEST WOULD APPRECIATE :)

Answer:

a. They are staying at the same speed

Can you please help me with this question

Answers

Answer:

First blank: spiral arms

Second blank: center

Explanation:

2. If temperature
increases/decreases, then air pressure will
increase/decrease.

Answers

Answer:

true

Explanation:

the mass of the temperature changes as well so it'll decrease and increase

How did chemists change Mendeleev's periodic table in the early 1900s?

Answers

Answer:

They used atomic number instead of atomic mass to organize the elements. From an element's location in the periodic table, you can predict: ... The elements have similar properties.

Josie draws models of the particles within a substance. Which model best represents the particles in
a solid?

D
A
B
C

Answers

D I'm pretty sure...........

5. __HCl + __NaOH-> __NaCl + __H2O

6. __FeS + __HCl-> __H2S + __FeCl2

7. __C2H4 + __O2-> __CO2 + __H2O

INEEDHELP

Answers

Answer:

umm is this free points? cause this looks very ummm weird

Explanation:

What happens to valence electrons in ionic bonding?

Answers

Answer:

they are either donated to or taken by another atom to achieve octet arrangement

Explanation:

for example Na+ and Cl- .. they both have one extra and one less electron .

so they donate and receive one electron to/from each other to achieve the octet arrangement ..

Atoms combine in whole-numbcher ratios.​

Answers

Ummm is there a picture u needed to attach orrrrrm

what is the molecular formula of benzoyl peroxide (c7h5o2) of the molecular mass is 0.242 kg/mol?(show work please)

Answers

Answer : The molecular formula of benzoyl peroxide is [tex]C_{14}H_{10}O_4[/tex]

Explanation :

Empirical formula : It is the simplest form of the chemical formula which depicts the whole number of atoms of each element present in the compound.  

Molecular formula : it is the chemical formula which depicts the actual number of atoms of each element present in the compound.  

For determining the molecular formula, we need to determine the valency which is multiplied by each element to get the molecular formula.

The equation used to calculate the valency is :

[tex]n=\frac{\text{Molecular mass}}{\text{Empirical mass}}[/tex]

As we are given that the molar mass of compound is, 0.242 kg/mol.

Molecular mass = 0.242 kg/mol = 242 g/mol      (1 kg = 1000 g)

The empirical mass of [tex]C_7H_5O_2[/tex] = 7(12) + 5(1) + 2(16) = 121 g/eq

[tex]n=\frac{\text{Molecular mass}}{\text{Empirical mass}}[/tex]

[tex]n=\frac{242}{121}[/tex]

[tex]n=2[/tex]

Molecular formula = [tex](C_7H_5O_2)_n[/tex] = [tex](C_7H_5O_2)_2[/tex] = [tex]C_{14}H_{10}O_4[/tex]

Thus, the molecular formula of benzoyl peroxide is [tex]C_{14}H_{10}O_4[/tex]

State the law of multiple proportions.

Answers

Statement that when two elements combine with each other to from more than one compound, the weights of one element that combine with a fixed weight of the other are in a ratio of small whole numbers.

Answer:

Law of Multiple proportion states that when two elements combine to form more than one compound, the mass of one element, which combines with a fixed mass of the other element, will always be ratios of whole numbers. For example, let us assume 2 molecules CO (carbon monoxide) and CO2(carbon dioxide).

Explanation:

pls help science

Which description properly describes the plant structures involved in photosynthesis?

Stomata take in water, sunlight, and carbon dioxide and release oxygen.
Phloem transports water, stomata take in carbon dioxide, and chlorophyll absorbs sunlight.
Xylem takes in water, sunlight, and carbon dioxide and releases oxygen.
Stomata take in carbon dioxide and release oxygen.

Answers

Answer:

Stomata take in water, sunlight, and carbon dioxide and release oxygen.

Explanation:

Photosynthesis collects and absorbs sunlight and converts the sunlight into sugars (glycose), then the plant stores the sugar and uses it.

2. The atomic number of an atom comes from *
The number of electrons.
The number of neutrons.
The number of protons.
Its atomic mass.

Answers

C. The number of protons

why does human cells perform more functions

Answers

Answer:

Human cells are eukaryotic which means they are more complicated, bacteria cells are prokaryotic which means they are simpler and viruses are not even cells at all, they are just genetic material in a protein shell. Not all bacteria make us sick, most actually help us have emunity to the virus. Hope this helps

Explanation:

Answer:

Cells are the basic building blocks of all living things. The human body is composed of trillions of cells. They provide structure for the body, take in nutrients from food, convert those nutrients into energy, and carry out specialized functions. Cells have many parts, each with a different function.

Explanation:

What type of
energy travels in the form of electromagnetic waves?

A: Chemical Energy
B: Gravitational Energy
C: Nuclear Energy
D: Radiant Energy

Answers

Gravitational energy.

Answer:

Radiant Energy

Explanation:

Radiant energy is created through electromagnetic waves

what is cell explain in a paragraph

Answers

Answer:

Cells are the basic building blocks of living things. The human body is composed of trillions of cells, all with their own specialised function. Cells are the basic structures of all living organisms. Cells provide structure for the body, take in nutrients from food and carry out important functions.

Who can help ? For BRAINLIST ( 6th grade work btw ) please help me

Answers

Answer:

Im not 100% sure but i think its option two or 1

Explanation:

What type of chemical reaction occurs when more energy is released during a chemical reaction than is needed to start a chemical reaction

Answers

Answer:

exothermic reaction

Explanation:

your welcome :)

Answer quickly plz. CO2 dissolving in bodies of water forms_____
which causes the pH to____? Fill in the blanks.

A. Carbonate Acid; decrease
B. Carbonic Acid; increase
C. Carbonic Acid; decrease
D.Carbonate Acid; increase.

Answers

CO2 dissolving in bodies of water forms carbonic acid which causes the pH to decrease.

Hope this helps! Please correct me if im wrong! :)

Answer:C. Carbonic Acid; decrease

Explanation:

Carbonic acid is formed and acid decrease pH

Please help ASAP! Which expression is equal to the number of kilograms (kg) in 3700 milligrams
(mg)?

Answers

Answer is C my g. Don't really know how to explain it.

How does temperature affect the vapor pressure of a liquid?

Answers

Answer:

As the temperature of a liquid increases, the kinetic energy of its molecules also increases. As the kinetic energy of the molecules increases, the number of molecules transitioning into a vapor also increases, thereby increasing the vapor pressure.

Other Questions
An 85 kg man stands in a very strong wind moving at 15 m/s at torso height. As you know, he will need to lean in to the wind, and we can model the situation to see why. Assume that the man has a mass of 85 kg, with a center of gravity 1.0 m above the ground. The action of the wind on his torso, which we approximate as a cylinder 50 cm wide and 90 cm long centered 1.2 m above the ground, produces a force that tries to tip him over backward. To keep from falling over, he must lean forward. Required:a. What is the magnitude of the torque provided by the wind force? Take the pivot point at his feet. Assume that he is standing vertically. b. At what angle to the vertical must the man lean to provide a gravitational torque that is equal to this torque due to the wind force? Juan deposits $1,500 into a savings account that pays 4.5% interest compounded annually. If Juan makes no deposits or withdrawals, how much money will be in his savings account after 3 years? What kind of a house do you live in? Houses come in all different sizes and shapes. Some are of wood while others are of stone or brick. Brick or adobe houses stay cool in the summer, yet are warm in the winter. The lightweight houses of Japan are designed to survive earthquakes. helpppEvaluate the expression.tell me answer pleaseee PLES REASON IT I NEED IT QUICKLYCustomers return 14% of their gifts during the holiday season. How many gifts were returned during the holiday season if 500 gifts were purchased? SOLVE THIS MATH PROBLEM PLEASE!!-4-2(4+-2)*3 Which sections are most relevant when determining how to purchasea ticket when taking a trip without changing trains?O A. "Ticket Purchases and Other Policies" and "Transit Fares"B. "Transit Fares" and "Transfers"C. "General Rail Transit Information" and "Suffolk CountyTransit Service: Observed Holidays"D. "Transfers" and "General Rail Transit Information" what happens to the neuron when u do drugs need a quick answer A B C D E F Rabbit populations can double every 30 days. If there are 26 rabbits on a farm, how many rabbits will be on the farm after 240 days? Use the Formula: Future Amount = { ](1+__)^{ } Question # 1. The following question has two parts. First, answer part A. Then, answer part B.Question # 1, Part AWhat is most likely the author's intent by mentioning the Rodeo Drive shopping spree in the following paragraph?When my parents said the three of us were moving out to California, to a place just north of Los Angeles, my mind immediately went to thoughts of Disneyland and Hollywood, glitz and glamour. I imagined a Rodeo Drive shopping spree to pick out a bikini for the endless days I would be spending on the beach. However, Id forgotten about my parents penchant for the unconventional; theyre definitely the road less traveled kind of people. Mom had a gopher snake for a pet when she was younger, and Dad was never happier than when he was climbing near-vertical cliffs that only mountain goats could love. These are not city folk.Question 1 options:To show that the narrator comes from a family that is used to spending money.To reveal the narrator as someone who is shallow and cares only for nice things.To contrast the narrator's grand dreams with the sparse life her parents have in mind.To emphasize the narrator's nervousness about moving to a place so far removed from civilization.Question # 2, Part BWhich sentence from the text best supports your answer in part A?Question 2 options:On the stone staircase that led to the front door, black lizards interrupted their push-ups to twist their heads and eye us as we passed.Our new home consisted of one bedroom, one bathroom, and one big room for everything else.Dad told me the real estate agent had mentioned that coyotes, bobcats, mountain lions, rattlesnakes, and even bears roamed these hills.In the city, or even in the suburbs where I had lived before, you could see only the brightest stars in the sky. A rectangle has length (3x+2) and width (2x+1) . Express the area of rectangle in terms of x. Note : Area of rectangle is = length . widthA,6x2+5x+36 x squared plus 5 x plus 3B,6x2+7x+26 x squared plus 7 x plus 2C.6x2+26 x squared plus 2D,(6x+3)open paren 6 x plus 3 close paren Bus A travels according to the function y = 125/2 x where y is distance travelled in miles and x is time in hours.Bus B travels according to the graph below, where the distance y is a function of time x. Which bus travels faster? Include all necessary calculations in your answer. Next Question!!? Help please... (1132 CHCH2CH = CH212. Give the complete IUPAC name for each of the following compounds:(a) (CH3)2CHF(b) CH3CHCICHCICH3(C)CH3CHCH;CH2CH3(d) CH3 CH2 CH = CHCHZ(e)CH3CH2CH2CHBCH2CH3CH2CH=CH2 6x + 8=5x + 12 i dont get this PLSSSSSS HURRYYYYYYYYWhich of these systems can be explained by Newtons laws of motion and gravitation?SELECT ALL THAT APPLY A.the motion of a race car on a racetrackB.the motion of Earth around the SunC.the motion of a ball falling on EarthD.the motion of electrons in an atom Marina is a 12-year-old girl who just did poorly on a math test. However, she believes that if she works harder next time, she will do better. According to Carol Dweck, what else is likely to be true about Marina 3. Which line segments are skew in the diagram?1)PQ and JN2) MQ and Ko3) ON and NQ4)OP and JM Twins Isaac and Isaiah were just born. Isaac weighs 6 pounds 2 ounces and Isaiah weighs 5 pounds 4 ounces. How many ounces do Isaac and Isaiah weigh together?