In a 3-digit number, the hundreds digit is one more than the ones digit and the tens digit is twice the hundreds digit. If the sum of the digits is 11, find the number. Plz give equation and answer.

Answers

Answer 1

Answer:

362

Step-by-step explanation:

Let the ones digit equal x. If the ones digit is one, then the hundreds digit is one more than it or x + 1. And, since the tens digit is twice the hundreds digit, you can say it is 2(x + 1) or as simplified: 2x + 2. Now, we are given the sum of the digits is 11, so if we add all of them, they should be equal to 11:

x + x + 1 + 2x + 2 = 11

We can combine like terms:

4x + 3 = 11

4x = 8

x = 2

So, the ones digit is 2. Since the hundreds digit is one more, it's 3. And because the tens is twice the hundreds, it's 6. The number is 362.

Answer 2

Answer:

362

Step-by-step explanation:

Hundreds:x

Tens:2x

Ones:x-1

x+2x+x-1=11=equation

3x-1=11

3x=12

x=4-1

x=3


Related Questions

PLEASE HELP IM BEING TIMED

Answers

Answer:

1

Step-by-step explanation:

Any number to the 0 power is equal to 1.

Hope that this helps!

Answer:

1 is correct

Any number that is raised to the power of 0 is 1, and any number that’s raised to the power of 1 is itself

PLS HELP ASAP!! need the answer

Answers

Answer:

60 degrees

Step-by-step explanation:

A silo contains 60,000 pounds of grain.

How many tons are in 60,000 pounds?

Answers

Answer:

30

Step-by-step explanation:

Answer:

30

Step-by-step explanation:

I took the quiz, I hope this helps!

Encuentre el volumen de 35 kg de oro

Answers

Speak in English so that I can understand

Write the inverse function for the function, ƒ(x) =1/2 x + 4. Then, find the value of ƒ -1(4). Type your answers in the box.

ƒ -1(x) =

ƒ -1(4) =

Answers

Answer:

0

Step-by-step explanation:

Given that f(x) = 1/2x + 4

Let y = f(x)

y = 1/2 x + 4

Replace y with x

x = 1/2 y + 4

Make y the subject of the formula

1/2y = x - 4

y = 2(x-4)

If x = 3

y = 2(4-4)

y = 2(0)

y = 0

Hence ƒ -1(4) is 0

the given tables shows the number of shirts and pants different people own. what number correctly completes the table so that each person has the same ratio of pants to shirts​

Answers

Answer:

He needs 15 shirts

Step-by-step explanation:

We can use a ratio to solve

4 pants             6 pants

--------------- = -------------

10 shirts            x shirts

Using cross products

4x = 10 *6

4x = 60

Divide each side by 4

4x/4 = 60/4

x = 15

He needs 15 shirts

67-2x+89/2+7-8x=0
help me please​

Answers

Answer:

x = 11.85

Step-by-step explanation:

[tex]67 - 2x + \frac{89}{2} + 7 -8x = 0\\\\67 + \frac{89}{2}+7 = 8x + 2x\\\\\frac{134 + 89 +14}{2} = 10x\\\\10x = 118.5\\\\x = 11.85[/tex]

Answer:

[tex]x = 11 \frac{17}{20}[/tex] or [tex]\frac{237}{20}[/tex]

Step-by-step explanation:

Isolate the variable by dividing each side by factors that don't contain the variable.

equations equivalent to x/4+1/3=5/6

Answers

If I rewrite this it would be
3x/12+4/12=10/12
3x=6
So your answer would be
2/4+1/3=5/6
Or
1/2+1/3=5/6
X=2

Solve for x. Round to the nearest tenth, if necessary.
S
9
х
Q
75°
R

Answers

Trigonometry:

Sine 75 = x/ 9
x = 9 Sine 75
x = 8.7

I only need help on number six

Answers

Answer:

288 inches = 8 yards

Step-by-step explanation:

Answer:

[tex]6 . \: 8 \: yards \: = \: 288 \: inches[/tex]

[tex]8. \: 18 \: feets \: = \: 216 \: inches[/tex]

[tex]10. \: \frac{1}{3} \: yards \: = 12 \: inches[/tex]

Step-by-step explanation:

6. 1 yard = 36 inches

8 yards = 36 × 8

= 288

8. 1 feet = 12 inches

18 feets = 12 × 18

= 216 inches

10. 1/3 into decimal = 0.33333333333

1/3 yards = 0.33333333333 × 36

= 12 inches

Hope it is helpful....

Dan spent 0.125 of his money in snacks, 1/4 on travelling and saved the
rest. If he saved $65, how much money did he have at first?​

Answers

Answer:

89.38

Step-by-step explanation:

65 times 0.125 = 8.125

65 times 0.25 = 16.25

16.25 plus 8.125 plus 65 = 89.38 dollars

THE Roger manages an ice cream stand. He keeps track of how many minutes each customer stands in line. Wait Times (in minutes 1.5 13 5 ET Roger wants to organize the data to make a line plot. Drag the numbers to show the frequency for each wait time Numbers may be used more than once. 4 || 5 Frequency 21 Hi Next >​

Answers

Answer:

0.5 = 2

0.75 = 2

1.0 = 3

1.25 = 4

1.5 = 5

2.0 = 2

2.25 = 1

2.5 = 1

What is the range of y= sec-'(x)? PreCal, send help please!!

Answers

Given:

The function is:

[tex]y=\sec^{-1}(x)[/tex]

To find:

The range of the given function.

Solution:

We have,

[tex]y=\sec^{-1}(x)[/tex]

The range of secant inverse function is:

[tex]Range=\{y|0\leq y\leq \pi , y\neq \dfrac{\pi}{2}\}[/tex]

The range of the given function in interval notation is:

[tex]Range=\left[0,\dfrac{\pi}{2}\right)\text{ and }\left( \dfrac{\pi}{2}, \pi\right ][/tex]

Therefore, the correct option is C.

The diagram shows a cubeAh=11.3cn correct to the nearest millimetre calculate the lower bound for the length of an edge of the cub you must show all your working

Answers

Answer:

Lower bound for the length of the edge = 42.5 cm

Step-by-step explanation:

From the picture attached,

FH is the diagonal of square EFGH.

Therefore, length of diagonal FH = [tex]\sqrt{FG^2+HG^2}[/tex]

(By applying Pythagoras theorem)

In triangle AFH,

AH² = AF² + FH²

       = AF² + [tex](\sqrt{FG^2+HG^2})^2[/tex]

       = AF² + FG² + HG²

AH² = 3HG²

(11.3)² = 3(HG²)

HG = [tex]\sqrt{\frac{127.69}{3}}[/tex]

HG = 42.563 cm

For distance correct to the nearest mm, lower bound for the length of the edge = 42.5 cm

And upper bound for the length of the edge = 43.6 cm

The side lengths of a cu be are congruent, so the edge length of the cu be is 65 mm

The length of diagonal A H is given as:

[tex]\mathbf{AH = 11.3cm}[/tex]

Considering triangle A FH, we have:

[tex]\mathbf{AH^2 = A\ F^2 + FH^2}[/tex]

So, we have:

[tex]\mathbf{11.3^2 = A\ F^2 + FH^2}[/tex]

Considering triangle HE F, we have:

[tex]\mathbf{FH^2 = EF^2 + EH^2}[/tex]

Substitute [tex]\mathbf{FH^2 = EF^2 + EH^2}[/tex] in [tex]\mathbf{11.3^2 = A\ F^2 + FH^2}[/tex]

[tex]\mathbf{11.3^2 = A\ F^2 + EF^2 + EH^2}[/tex]

The side lengths of a cu be are congruent.

This means that: A F = EF = EH

So, we have:

[tex]\mathbf{11.3^2 = A\ F^2 + A\ F^2 + A\ F^2}[/tex]

Evaluate like terms

[tex]\mathbf{11.3^2 = 3A\ F^2}[/tex]

Evaluate squares

[tex]\mathbf{127.69 = 3A\ F^2}[/tex]

Divide both sides by 3

[tex]\mathbf{42.563= A\ F^2}[/tex]

Take square roots

[tex]\mathbf{6.52= A\ F}[/tex]

Rewrite as:

[tex]\mathbf{A\ F = 6.52cm}[/tex]

Convert to m m

[tex]\mathbf{A\ F = 6.52 \times 10mm}[/tex]

[tex]\mathbf{A\ F = 65.2\ mm}[/tex]

Approximate

[tex]\mathbf{A\ F = 65\ mm}[/tex]

Hence, the edge length is 65 mm

Read more about cu bes at:

https://brainly.com/question/23261883

Kirenna's boss, Tanae, believes that women are not capable of making top-level decisions. Kireena's decisions are often sidelined by those of Tanae. When Kirenna confronts Tanae, he terminates her employment. Which of the following is the most appropriate suit that will help Kirenna?

a. a retaliation lawsuit
b. a forgery lawsuit
c. a reverse discrimination suit
d. a public policy violation lawsuit
e. a civil right infringement lawsuit

Answers

Answer:

e. a civil right infringement lawsuit

Step-by-step explanation:

A civil right infringement lawsuit is a lawsuit filed by an offender whose civil rights have been violated by others. Civil rights are those rights of the citizens that is guaranteed by the Constitution of the United States to its people. They are right to equality, right to freedom, right to employment and all those rights that is included in the Bill of Rights of the US constitution.

So, when Kirenna was terminated by her boss, Tanae on the grounds on the discrimination of gender, Kirenna can file a civil right infringement lawsuit against her boss, Tanae.

What is the area of the figure? NO LINKS!!

Answers

Answer:

Area of the figure is 88 square inches

A survey of 35 people was conducted to compare their self-reported height to their actual height. The difference between reported height and actual height was calculated. You're testing the claim that the mean difference is greater than 0.7. From the sample, the mean difference was 0.95, with a standard deviation of 0.44. Calculate the test statistic, rounded to two decimal places

Answers

Answer:

The test statistic is t = 3.36.

Step-by-step explanation:

You're testing the claim that the mean difference is greater than 0.7.

At the null hypothesis, we test if it is 0.7 or less, that is:

[tex]H_0: \mu \leq 0.7[/tex]

At the alternate hypothesis, we test if it is greater than 0.7, that is:

[tex]H_1: \mu > 0.7[/tex]

The test statistic is:

[tex]t = \frac{X - \mu}{\frac{s}{\sqrt{n}}}[/tex]

In which X is the sample mean, [tex]\mu[/tex] is the value tested at the null hypothesis, s is the standard deviation and n is the size of the sample.

0.7 is tested at the null hypothesis:

This means that [tex]\mu = 0.7[/tex]

Survey of 35 people. From the sample, the mean difference was 0.95, with a standard deviation of 0.44.

This means that [tex]n = 35, X = 0.95, s = 0.44[/tex]

Calculate the test statistic

[tex]t = \frac{X - \mu}{\frac{s}{\sqrt{n}}}[/tex]

[tex]t = \frac{0.95 - 0.7}{\frac{0.44}{\sqrt{35}}}[/tex]

[tex]t = 3.36[/tex]

The test statistic is t = 3.36.

what is 10000000000+10000000000

Answers

Answer:

20000000000000000000000000000

if you found any words about mathematics, tell me please

Answers

Answer:

geometry

Step-by-step explanation:

left side of paper

how to find the surface area of composite figures

Answers

A composite 3D figure is a three dimensional figure made up of basic three dimensional figures such as cubes, prisms, pyramids, cylinders, cones, etc. To find the surface area of a composite 3D figure, add the areas of each geometric figure making up the composite 3D figure.

2
0
-1
-2
2
-2
(-3.4)
What is the equation of the given line?
y = -4x
x = -4
y = -4

Answers

Answer:y=-4

Step-by-step explanation:

PLEASE HELP



what's x
cos(x+pi)-sin(x-pi)=0

please show work​

Answers

sin(x+pi)=-sin(x)=sin(-x)=cos(pi/2)

cos (x+pi)=-cos(x)

So according to the question:

cos(pi/2 +x)=cos(x)

Using the solution of cos, obtain:

(pi/2) + x = 2pi +- (x)

case#1: (pi/2) + x = 2pi + (x)

But here, the value of x is canceled, just

case#2: (pi/2) + x = 2pi - (x)

answer------------>>>>>>>>> x=pi-pi/4

Indra was is wrapping the blocks below how much wrapping paper does she need

Answers

Answer:

D) 180

Step-by-step explanation:

Formula for Surface area of Rectangular prism is

A = 2(lw+wh+lh)

A = 2(6*8 + 8*3 + 6*3)

A = 2(48 + 24 + 18)

A = 2 * 90

A = 180

match the prefixes with the metric unit ​

Answers

Answer:

kilo =1*10^3 grams

nano=one millionth

micro=0.01 litres

centi=0.0000000001 meters

Step-by-step explanation:

Students were asked whether they walk, drive, or ride the bus to school. The results. by gender, are shown in the table.
Walk Drive Ride Bus
Male 30 60 10
Female 20 50 30

Select all the statements that illustrate conditional probability?
A. of all students, the probability of choosing a male.
B. Of the students who walk, the probability of choosing a female.

OC. of all students, the probability of choosing a male who walks.
D. Of the females. the probability of choosing one who rides the bus.
E. Of all students, the probability of choosing a student who drives.

Answers

Answer:

B. Of the students who walk, the probability of choosing a female.

D. Of the females, the probability of choosing one who rides the bus.

Step-by-step explanation:

Conditional probability is the chance of something happening provided that something else has previously occured (think dependent events).

For example, the probability of getting into college P(college) is Event A.

The probability of receiving dormitory housing P(housing) is Event B.

First, the person must get into college before they are even able to receive dormitory housing. Therefore, this is a situation of conditional probability. The "condition" of being accepted into the college (Event A) is necessary before the individual can attempt Event B, housing.

The key word in the question is "Of all the students." This means that from the first instance, you are only calculating one probability.

However, in B, it first singles out "all the students who walk."

Therefore p(walk) must be met before p(gender) can happen.

Same with D, it singles out "of the females."

Therefore p(gender) must be met before p(transportation) can happen.

C does have two categories, but since it is still out of the general draw pool "of all students," it is not conditional. No condition needs to be met first to choose a male who walks out of ALL students.

For the data in the table, does y vary directly with x? If it does, write an equation for the direct variation.

TABLE

x y
-------
2 10
4 24
6 36​

Answers

Answer:

y does not vary directly with x

Step-by-step explanation:

The equation for direct variation is

y = kx ← k is the constant of variation

If k is constant for all ordered pairs in the table then direct variation.

k = [tex]\frac{y}{x}[/tex]

(2, 10 ) → k = [tex]\frac{10}{2}[/tex] = 5

(4, 24 ) → k = [tex]\frac{24}{4}[/tex] = 6

(6, 36 ) → k = [tex]\frac{36}{6}[/tex] = 6

Since k is not constant for all pairs then y does not vary directly with x

What is the area of the following picture ( HELP PLEASE )

Answers

Answer:

area=l*b

10*8

80#

Step-by-step explanation:

hope you like it

Jake studied
z
hours for a big test. Julie studied half as long.

Write an algebraic expression for long Julie studied.

Answers

Answer:

(1/2)z

Step-by-step explanation:


PLS ANSWER RN

What is the area of AJKL?

Answers

Answer:

8.5

Step-by-step explanation:

slope of the line that contains KL

(y2 - y1)/(x2-x1)

(0-1)/(7-3)

m = -1/4

slope of the line that contains JK

(5-1)/(4-3)

m = 4

the linea are perpendicular so triangle is right

area = (leg1 x leg2)/2

KL = [tex]\sqrt{(7-3)^2 + (0-1)^2} = \sqrt{16 + 1} = \sqrt{17}[/tex]

KJ = [tex]\sqrt{(4-3)^2 + (5-1)^2}= \sqrt{1 + 16} = \sqrt{17}[/tex]

area = (√17)^2/2 = 17/2 = 8.5

8.5



….hope this helps!

The perimeter of the figure below, in inches.

Answers

Answer:

just use a calculator and add all the numbers-

Step-by-step explanation:

add

Other Questions
Sandy mixed together 9 gallons of one brand of juice and 8 gallons of a second brand of juice, which contains 48 percent real fruit juice. Find the percent of real fruit juice in the first brand if the mixture contained 30 percent real fruit juice. Which of the following equations could be used to solve this?Group of answer choicesa(9)+48(8)17=0.30100a(9)+0.48(8)17=30100a(9)+0.48(8)a+0.48=30100a(9)+0.48(8)17=30 what led napoleon to invade russia which eventually led to his downfall a. Russia refused to follow continental systemb. Russia aligned with Britainc. russia aligned with Prussia d. russia had all the oil The starting numbers and why are already entered in the table below the blanks and the table represent the next two terms for each of the patterns the pattern for the X values is add 2 the pattern for the Y values is add 4 which graph represents ordered ordered pairs of the first three terms of the patterns from the table? How does Bottom act when he rejoins the workmen at Quinces house? What are the common elements found in the structure of fats, carbs, protein, and vitamins? What about in minerals? At a high school the average grade for the first semester for all subjects was 79.3. Based on this mean , the principal concludes that half of the grades were 79.3. Higher is her conclusion justified? Why or why not? SOMEONE DO THIS FOR ME I WILL GIVE BRAINLIEST.NO LINKS Analysts expect Placer Corp. to pay shareholders $2.25 per share annually for the next five years. After that, the dividend will be $3.50 annually forever. Given a discount rate of 12%, what is the value of the stock today What do you think happens to the price of an object as it goes through a large number of intermediaries? What is the definition of the Turkish flag? What does it convey? Write about anything you want, but make sure it is an event or feeling that is important to you. If you are writing about an event, write every detail you can remember, including the scenery and any dialogue.For example, an event that is very important to me is my last baseball game ever, where I lost in the championship game during my senior year of high school.Write as much as you can, but try to write enough to finish a page.GIVING BRAINLIEST! Identify the percent of change as an increase or decrease. $24 to $18 Hurry plz In which quadrant is the point (-5, -4) in?IVIIIIII Fill in the blank in the following sentence with the appropriate adjectivebelow. Note the hint in parentheses.Les plages de Floride sont vraiment trs(beautiful)A. beauB. beauxC. propresO D. belles The water level in an ocean bay changes at an average rate of 3 meters per hour. At this rate, how many hours would it take for the water level to change 12 meters? please help Which section of Declaration of Independence explains what the British government has done to anger the colonists ProdigyImage result for ani.Coordinate Plane1180/114Streak608 50th32110What is the order in which the body eliminateswaste from the cells. From beginning to endingwith the exit from the body.blood stream, blood stream,kidnout, blood kidneys, bloodkidneys, ureters, kidneys, urethra, stream, bladder, stream, urethra,bladder, urethra, bladder, ureters, uruters, urethra urethra, bladder,outside the body outside the body outside the body outside the body.Music offZoom in11:55Boom Use the Law of Sines to solve for the variable. Round your answer to thenearest whole number. Write the value only. * If using the method of completing the square to solve the quadratic equation x^2+5x+10=0x 2 +5x+10=0, which number would have to be added to "complete the square"? How did racism change against minorities begin to change after the Civil Rights Movement ?