How do you write 9.085 x 10-9 in standard form?

Answers

Answer 1

Answer: 0.000000009085

Step-by-step explanation: This expression is rewritten like this because it is multiplied by a negative power of ten. Therefore, applying this principle to scientific notation, the answer would have to be less than 0. That would be your answer. Hope this helps!


Related Questions

Find the value of x.

Answers

Answer:

The value of x is 5x that the value of X in my oppion.

Step-by-step explanation:

can someone please help me with this i’d really appreciate it

Answers

Step-by-step explanation:

a probability is always

desired cases / total possible cases.

there is the theoretical probability in such cases, where we simply assume that all sides of such a die (or solid) truly have the same probability.

and then we have experimental probability, where we use only the actual data we got in the experiments to calculate the probability of that particular die (with all its actual internal imperfections) to roll certain results.

so, in our experiments how many total cases do we have ?

200.

how many desired cases (a number greater than 10, that means 11 or 12 as result) do we have ?

well, the sum of all appearances of 11s and 12s :

16 + 18 = 34

that means our experimental probability to get a number greater than 10 is

34/200 = 17/100 = 0.17

FYI

while the theoretical probability with an ideal die is

total cases : 12 (1 .. 12)

desired cases : 2 (11, 12)

the probability is

2/12 = 1/6 = 0.166666666...

it is actually a tiny little bit lower than what we observed in the experiments.

HELP PLS I'LL MARK U BRAINLIST

Answers

Answer:

this answer is of 2nd question

Step-by-step explanation:

since it is an isosceles triangle

3y-1=y+11

3y-1=y+113y-y=11+1

2y=12

y=6

now putting the value of y in 3y-1,y+11,4y-9

we get,

3y-1=3*6-1=17

y+11=6+11=17

4y-9=4*6-9=15

the answer is 17,17,15

On a piece of paper, graph y = x² - 2x - 8 and identify the zeros. Then
determine which answer choice matches the graph that you drew and
correctly identifies the zeros.

Answers

This is what the graph should look like. The zeros are where the graph crosses the x-axis, which is at x= -2 and x= 4.

I am very confused and so are my classmates.

Answers

Answer:

I used A and got 0.4 and she needs 52200

Step-by-step explanation:

MATHHH!!! area stuff

Answers

Answer:

112

Step-by-step explanation:

▪︎ Volume of pyramid = (1/3) * base area * height

▪︎ Base area = 8 * 7

▪︎ Height = 6

▪︎ Volume = 8 * 7 * 6 / 3 = 112

Katherine is landscaping her home with juniper trees and pansies. She wants to arrange 15 pansies around each of 8 trees. Each tree costs $20.75 and a six-pack of pansies costs $2.50. Explain how to write an expression to find Katherine’s final cost

Answers

The expression that signifies Katherine’s final cost F= P + T= $466

Calculation of final cost

The number of pansies to be arranged around each tree = 15 pansies

The cost of pansies(P) = 15 × 8 × 2.50 = $300

The number of juniper trees available = 8

The cost of the trees available(T) = 8 × 20.75= $166

Therefore Katherine's final cost(F)= $300 + $166 = $466

The expression to find Katherine’s final cost = F= P + T

Learn more about addition here:

https://brainly.com/question/24536701

#SPJ1

George is building a fence around a rectangular dog run. He is using his house as one side of the run. The area of the dog run will be 240 square feet. The length of the run is 30 feet, and the width is (30 minus x) feet. The diagram below shows his plan.

Recall the formulas for area and perimeter: A = lw and P = 2l + 2w.


A rectangle labeled Dog run has a length of 30 feet and width of (30 minus x) feet.

How many feet of fencing will George need for the dog run?

Answers

Answer:

width is 30-22 = 8 feet

George would need 76 feet of fencing for the dog run

Step-by-step explanation:

30 x (30-x) = 240

30-x = 8

-x = -22

x = 22

Therefore width is 30-22 = 8 feet

8+8+30+30 = 76

Thus, George would need 76 feet of fencing for the dog run

Jamie is playing a card game. Jamie's score changes by -12 points for 8 turns in a row.
What is the total change in Jamie's score?

Answers

Your answer will be negative 96

Answer:-96

Step-by-step explanation:The answer is -96

A function, f, has an x-intercept at (2,0) and a y-intercept at (0.10)

Answers

The equation of the function is f(x) = -5x + 10

How to determine the function equation?

The points are given as:

x-intercept at (2,0) and a y-intercept at (0,10)

A linear function is represented as:

y = mx + b

Where b is the y-intercept.

The y-intercept at (0,10) means that:

b = 10

So, we have:

y = mx + 10

The x-intercept at (2,0) means that:

x = 2, when y = 0

Substitute these values in y = mx + 10

0 = 2m + 10

Subtract 10 from both sides

2m = -10

Divide both sides by 2

m = -5

Substitute m = -5 in y = mx + 10

y = -5x + 10

Hence, the equation of the function is y = -5x + 10

Read more about linear functions at:

https://brainly.com/question/4025726

#SPJ1

A function, f, with an x-intercept at (2,0) and a y-intercept at (0, 10) has an equation y = -5x + 10

How to find the equation of a line?

The equation of a line in slope intercept form is expressed as y =x +b

where

m is the slopeb is the y-intercept

Given a function, f, has an x-intercept at (2,0) and a y-intercept at (0, 10), the slope is expressed as:

Slope = 10/-2
Slope = -5

Substitute m = -5 and b = 10 into the formula to have y = -5x + 10

Learn more on equation of a line here: https://brainly.com/question/27680685

#SPJ1

Samuel can type 40 words per minute. How many hours would it take him to type
2.6 x 10^5 words?

Answers

Answer:

108 1/3 hours

Step-by-step explanation:

There are 60 minutes in 1 hours.

40 words/minute × 60 = 2400 words/hour

2.6 × 10^5 / 2400 = 108.3333... = 108 1/3

Answer 108 1/3 hours

The length of one leg of an isosceles right triangle is 3 ft. What is the perimeter of the triangle?
O 3+3√2 ft
O 3+3√√3 ft
O 6+3-√√2 ft
O 6+3√√3 ft

Answers

Check the picture below.

The perimeter of the triangle with the given dimension of leg is 6+3√2.

What is Pythagoras theorem?

In a right-angled triangle, the square of the hypotenuse side is equal to the sum of the squares of the other two sides, according to Pythagoras's Theorem.

Using Pythagoras theorem

c² = a² + b²

where c is the hypotenuse.

Here, c² = 3² + 3²

c = 3√2

So, the perimeter of triangle is

= 3 + 3 + 3√2

= 6 + 3√2

Learn more about Pythagorean theorem here: brainly.com/question/343682

#SPJ5

​Point RR lies on the directed line segment from L\left(-8,-10\right)L(−8,−10) to M\left(4,-2\right)M(4,−2) ​and partitions the segment in the ratio 33 to 55. ​ ​What are the ​coordinates of point RR? ​

Answers

The coordinates of point R of the given line segment are (-3.5, -7)

How to partition a line segment?

We are given the coordinates;

L (-8,-10) to M (4,-2)

We are told that they are partitioned in the ratio 3 to 5.

Thus;

The coordinates of R divide directed line segment from L (-8,-10) to M (4,-2) in ratio 3:5will be :

x = [3(4) + 5(-8)]/(3 + 5)

x = -3.5

y = [3(-2) + 5(-10)]/(3 + 5)

y = -7

Thus, the coordinates of point R are (-3.5, -7)

Read more about Line segment at; https://brainly.com/question/13293903

#SPJ1

Graph the solution to this system of inequalities in the coordinate plane.

Answers

For the system of equations, we need to plot a straight line passing through the intercepts.

Inequality Graphs

Inequalities are equations separated by an equal sign. Given the following system of inequality

3y >2x + 12

2x + y ≤ -5

For the system of equations, we need to plot a straight line passing through the intercepts.

For the inequality 3y >2x + 12, the upper part of the graph will be shaded and the line dashed.

For the inequality 3y >2x + 12, the lower part of the graph will be shaded and the line solid.

The graph of the system of equations is graphed below

Learn more on inequality graphs here: https://brainly.com/question/24372553

#SPJ1

Which represents the inverse of the function f(x) = 4x?
O h(x) = x +4
O h(x) = x-4
O h(x) = =x
h(x) = ÷x

Answers

Answer:

h(x) = 1/4 x

Step-by-step explanation:

h(x) = x + 4, h(x) = x – 4, h(x) = 3/4 x, h(x) = 1/4 x. Summary: The equation which represents the inverse of the function f(x) = 4x is h(x) = 1/4 x.

plaese explain this exe i can't understand and tomorrow i have an exman of metahmatice

Answers

Answer:

  B: 610; A: 202,000

  D: 253; C: 2,007,000

Step-by-step explanation:

These are all expressions that can be calculated as is, or that can be simplified a little bit by taking advantage of the distributive property and other properties of addition and multiplication. The idea is to look for numbers that show up more than once, and rearrange the expression so they only show up once.

__

B = (597 -176) +(13 +176)

This is a straight addition problem. The two "176" values have opposite signs, so cancel when they are added. Using the associative and commutative properties of addition, we can rearrange this to ...

   597 +13 +(-176 +176)

  = 597 +13

This can further be rearranged to ...

  = (597 +3) +(13 -3)

  = 600 +10

  = 610

__

A = 2020×173 -2020×73

The factor 2020 can be put outside parentheses using the distributive property:

  = 2020(173 -73)

  = 2020×100

  = 202,000

__

D 17×15 -15 +13

The value 15 is repeated. Terms using it can be combined using the distributive property.

  = 15(17 -1) +13

  = 15(16) +13

  = 240 +13

  = 253

Another way to look at this one is to use the factoring of the difference of squares.

  = (16 +1)(16 -1) +(-15 +13)

  = 16² -1² +(-2)

  = 256 -3

  = 253

__

C 2019×890 -(12000 -2019×110)

Again, we can focus on rearranging so 2019 only needs to show up once.

  = 2019(890 +110) -12000

  = 2019×1000 -12×1000

  = (2019 -12)×1000

  = 2,007,000

i dont now what it is

Answers

Answer:

Its option C

As,

x+8=3x

8= 3x-x

8=2x

8/2=x

4=x

#x=4

Select the correct statement about the function represented by the table

Answers

The correct statement about the function represented by the table will be option (D) It is linear function because the y-value increases by an equal difference over equal interval of x-values

The terms "linear function" in mathematics apply to two different but related ideas: A polynomial function of degree zero or one that has a straight line as its graph is referred to as a linear function in calculus and related fields.

Given a table on which there are two column in which one column represents x values while other column represent the y values

We have to find whether the relationship between x value and y value is linear or exponential

From given table let,

y₁ = 34; y₂ = 41; y₃ = 48; y₄ = 55

x₁ = 1; x₂ = 2; x₃ = 3; x₄ = 4

If the relationship between the x value and y value is linear then the difference between two consecutive value of x value and y value would be equal

So y₂-y₁ = y₄-y₃ and x₂-x₁ = x₄-x₃

Putting the value we get difference of y value 7 and x value as 1 since it is same we can say that the relation ship between x value and y value is linear

Hence the correct statement about the function represented by the table will be option (D) It is linear function because the y-value increases by an equal difference over equal interval of x-values

Learn more about linear function here:

https://brainly.com/question/4025726

#SPJ10

is the statement 15=|-15| true

Answers

Answer:

Yes! |-15| = 15

Step-by-step explanation:

Many people think of absolute value (the two bars symbol around the -15) as ALWAYS POSITIVE.

You can also think of absolute value as a distance. If you move 15 units, it doesn't matter in what direction you go. 15 units travelled is 15 units.

Lastly, absolute value has a V-shaped graph, that is because its always positive.

Yes, the lines on either side of the number -15 mean absolute value. Meaning that whatever number inside of the lines is positive.

Alison is buying binders for school. small binders cost $3 each, and large binders cost $5 each. if alison needs to buy at least 12 binders and has no more than $45 to spend, what is the maximum number of large binders she can buy?

Answers

Answer:

your answer is 9 large binders

Review the graph of 2x – 7 – 3 ≥ y.

On a coordinate plane, a curve goes through (0, negative 3) and increases up through (8.5, 0) and (10, 5). Everything below the line is shaded and is labeled 2 Superscript x minus 7 Baseline minus 3 greater-than-or-equal-to y.

What is the least integer value that satisfies the inequality 2x – 7 ≥ 3?

7
8
9
10

Answers

The least integer value that satisfies the inequality   [tex]2^{x-7} - 3[/tex] ≥ y is 7.

What is Exponential function?

Exponential function, as its name suggests, involves exponents. But note that, an exponential function has a constant as its base and a variable as its exponent but not the other way round.

Here, In the given function

            Least possible value of 2ˣ⁻⁷ is 1

                     2ˣ⁻⁷ = 2⁰

    On comparing both sides, we get

                 x-7 = 0

                  x = 7

Thus, The least integer value that satisfies the inequality   2ˣ⁻⁷-3≥ y is 7.

Learn more about Exponential function from:

https://brainly.com/question/14355665

#SPJ1

Answer:

7

Step-by-step explanation:

edg 2022

The length of three boards added together is 7.2 meters. The second board is twice the length of the first. The third board is three times the length of the first. What is the length of the three boards?

Answers

Answer:

Board 1 = 1.2m

Board 2 = 2.4m

Board 3 = 3.6m

Step-by-step explanation:

Board 1 = x

Board 2 = 2x

Board 3 = 3x
x + 2x + 3x = 6x

7.2 /6 = 1.2

Board 1 = 1.2

Board 2 = 2 (1.2) = 2.4

Board 3 = 3 (1.2) = 3.6

I'm confused I got an answer but got it wrong help please. ​

Answers

Answer:

[tex]y = \frac{2}{3}x -6[/tex]

Step-by-step explanation:

I'm just gonna assume you want the equation of the line

Standard slope-intercept form is [tex]y=mx+b[/tex] with [tex]m[/tex] being the slope [tex]\frac{rise}{run}[/tex] (aka [tex]\frac{y_1 - y_2}{x_1 - x_2}[/tex]) and [tex]b[/tex] being the y-intercept (the point where the line crosses the y-axis)

First we will find the slope using the 2 points on the line.

[tex]\frac{-2 - (-4)}{6-3} = \frac{2}{3}[/tex]

This means our slope ([tex]m[/tex]) is [tex]\frac{2}{3}[/tex].

Next we can find our y-intercept. The line crosses the y-axis at [tex](0, -6)[/tex] meaning the y-intercept ([tex]b[/tex]) is -6.

Finally we can plug in our values and find the equation of the line.

[tex]y = \frac{2}{3}x -6[/tex]

That might be the answer (i don't know the question)

- Kan Academy Advance

1 pound is equivalent to ____ grams.

Answers

Answer:

453.592 grams or 454 grams if you round up

Answer:

1 pound = 454 grams

Step-by-step explanation:

Multiply 454 into the value.

The function g(x) = -2x + 3. Compare the slopes and y-intercepts. A. Both the slopes and the y-intercepts are different. B. Both the slopes and the y-intercepts are the same. C. The slopes are the same but the y-intercepts are different. D. The slopes are different but the y-intercepts are the same. ​

Answers

Answer:

both the slopes and the y intercepts are the same for both of these functions because if you look at the graph you will notice that the y intercept is positive 3 just the function and to get its slope just use the formula y2-y1/x2-x1 to get the slope of also a -2 so answer is b

what does permimeter mean

Answers

Total distance around a shape

Okay I will see if it was okay to say that I don’t got the wrong ones and I don’t just know that they are all wrong but they ain’t got me mad at me like I’m so tired of them and I’m not mad about you too I’m just not mad about that I’m tired I love it so I’m not going home now but yeah yeah that’s what you mean I

_____cups flour is equivalent to 1 pound.

Answers

3 1/2 cups will be your answer !

Find the equation to the line below.

Answers

Answer:

y=-1/1x

Step-by-step explanation:

First, let's take the slope of a line equation:

y=mx+b

Now, all we have to do is find the slope(m) and the y-intercept(b).

The line intercepts the y axis at 0, so b=0.

Next, find the slope.

The equation to FIND slope is rise/run, so we can solve that:

1/1=1, but since the line goes down, it's negative.

The slope is 1, so m=1.

Now, put that into m.

y=-1x+0, but we don't need 0, so the answer is y=-1x.

A cylindrical vase is 10 centimeters in height. When
filled to the very top, it holds 125 cubic centimeters of
water. What is the radius of the vase, rounded to the
nearest tenth? Explain or show your reasoning.

Answers

The measure of the radius of the cylinder to the nearest tenth is 1.7cm

Surface area of a cylinder

The formula for calculating the surface area of a cylinder is expressed as:

S = 2πr(r+h)

Given the following

S=. 125cm²

h = 10cm

Substitute

125 = 2πr(r+10)

Expand

125 = 2(3.14)r² + 20(3.14)r
6.28r² + 62.8r - 125 = 0

Factorize

On factorizing, the measure of the radius of the cylinder will be 1.7cm

Learn more on surface area here: https://brainly.com/question/16519513

#SPJ1

A group of middle and high school students are surveyed as to their breakfast preferences. The results are shown below.
Eat Breakfast
Skip Breakfast
Middle Schooler
40
14
High Schooler
12
24
Total
52
38
What is the probability a randomly selected student eats breakfast?
What is the probability a randomly selected student is a middle schooler?
What is the probability a randomly selected student is either a high schooler OR eats breakfast?
What is the probability a randomly selected student is a high schooler AND eats breakfast?
What is the probability a randomly selected student is a high schooler, given that they eat breakfast?
What is the probability a randomly selected student eats breakfast given the student is a high schooler?
Total
54
36
90

Answers

The probability a randomly selected student eats breakfast is 0.58.

The probability a randomly selected student is a middle schooler is 0.60.

The probability a randomly selected student is either a high schooler OR eats breakfast is 0.98.

The probability a randomly selected student is a high schooler AND eats breakfast is 0.23.

The probability a randomly selected student is a high schooler, given that they eat breakfast is 0.33.

The probability a randomly selected student eats breakfast given the student is a high schooler is 0.23.

What are the probabilities?

The probability a randomly selected student eats breakfast = number of students that eat breakfast / total number of students

52 / (52 + 38) =  0.58.

The probability a randomly selected student is a middle schooler = total number of middle schoolers / total number of students = (40 + 14) / 90 =  0.60.

The probability a randomly selected student is either a high schooler OR eats breakfast = (total number of high schoolers / total number of students) + (number of students that eat breakfast / total number of students) = 36 / 90 + 52 / 90 =  0.98.

The probability a randomly selected student is a high schooler AND eats breakfast = (total number of high schoolers / total number of students) x (number of students that eat breakfast / total number of students) = 36 / 90 x 52 / 90 =  0.23.

The probability a randomly selected student is a high schooler, given that they eat breakfast = high schooler that eats breakfast / total number of students that eat breakfast

12 / 52 =  0.33.

The probability a randomly selected student eats breakfast given the student is a high schooler = high schooler that eats breakfast / total number of high schoolers = 12 / 36 = 0.23.

To learn more about probability, please check: https://brainly.com/question/13234031

#SPJ1

Other Questions
a. 1.2K =what is the ohms It cost Makayla $2.80 to send 28 text messages. How much would it cost to send 163 text messages? All aspects of the Kirby-Bauer test are standardized to assure reliability. What might be the consequence of pouring the plates 2mm deep instead of 4mm deep please help Which statement is true about a nickel-cadmium dry cell?The anode reaction is NiO2+H2O+2eNi(OH)2+2OH.The cathode reaction is Cd+2OHCd(OH)2+2e.The cathode reaction is NiO2+H2O+2eNi(OH)2+2OH.The cathode reaction is Cd+NiO2+2H2OCd(OH)2+Ni(OH)2. A die has six sides, with the numbers 1, 2, 3, 4, 5, and 6. What is the probability of rolling a number greater than 2? Rachel rides her bike due east at 9 miles per hour. Amos rides his bicycle due north at 12 miles per hour. If they left from the same point at the same time, how far apart will they be in 1 hour? Geometry and measurement :))) help please. In a city, the distance between the library and the police station is 3 miles less than twice the distance between thepolice station and the fire station. The distance between the library and the police station is 5 miles. How far apartare the police station and the fire station?O 1 mileO 3 milesO4 milesO6 miles The probability of rain on the last day of July is 95 % . If the probability remains constant for the first seven days of August , what is the probability that it will rain at most two of those seven days in August ? Find the Mean , Standard Deviation , and Variance . If you wanted to make the graph of y=3x+1 steeper which equation could you use PLSS ANSWER MY QUESTION IN THE PICTURE NONSENSE ANSWER REPORT WRONG ANSWER REPORT CORRECT ANSWER brainlist or follow The number scale used on this map is 1:10 000 000 explain what this scale means? 7. The perimeter of a circle of diameter 10 cm is- (a) 30.4 cm. (b) 30.14 cm (c) 31.4 cm. (d) 30.01 cm.(Take = 3.14) a trophic pyramid for southern lake michigan coastalplease answer it Which function has the greater slope and what does it represent? the in-line skate function has the greater slope, which shows that the cost per hour is greater than that of the bicycles the in-line skate function has the greater slope, which shows that the cost per hour is less than that of the bicycles. the bicycle function has the greater slope, which shows that the cost per hour is greater than that of the in-line skates. the bicycle function has the greater slope, which shows that the cost per hour is less than that of the in-line skates. SUPER EASY POINTS, i also need some clarification on this question... would i be correct? Construction This section of a concrete skateboard ramp has the shape of a triangular prism. Find the volumeof the triangular prism. Find the value of the concrete used in the ramp if the cost of concrete is $4.00 per cubicfoot. 1Collin is writing a compare and contrast paragraphabout different language courses offered at his school.Point: English is the most common language in theUnited States, but people also speak French andSpanish.Illustration: More than 37 million people over the ageof five speak Spanish in the U.S., and approximately 2million people speak French.seReport 05 pdfLOType here to searchOiiC1023567Based on the point and illustration, which is the bestexplanation or analysis of the evidence?Spanish classes are more difficult than Frenchclasses.Spanish classes are more interesting than Frenchclasses.Spanish would be more limiting for students thanFrench.O Spanish would be more useful for students ineveryday life.60F Mostly clear AD.6 At a beauty supply company, an employee created a popular line of lip balm, lip gloss, and lipstick after many hours of research and discussions with experts. Now, with their manager's encouragement, they frequently conduct workshops for other employees about lip color and other beauty products. In this scenario, which feature of the company is exemplified How did the views of Woodrow Wilson and his European allies differ at the Conference of Versailles? (Site 3) How does the repetition of the words "A light!" in the last stanza affect the poem?Read the poem.Columbusby Joaquin Miller A.It suggests the mate's excitement at finally seeing starlight to help guide them.B.It implies that the men on the ship have spotted lights on the shoreline.C.It conveys a suspenseful mood that the mate spotted another ship on the ocean.D.It creates a light-hearted tone that the men have finally reached their destination.