give the systematic name of the alkene, indicating cis or trans configuration. systematic name:

Answers

Answer 1

If the alkene is 2-butene and the substituents on the second carbon are a methyl group and a hydrogen, the cis isomer would be (Z)-2-butene and the trans isomer would be (E)-2-butene.

To give the systematic name of an alkene, you first need to identify the longest carbon chain containing the double bond. Then, you add the suffix "-ene" to the name of the parent hydrocarbon and indicate the position of the double bond with a number. For example, if the longest carbon chain is 6 carbons long and contains a double bond between carbons 2 and 3, the systematic name would be hex-2-ene.

To indicate the cis or trans configuration of the alkene, you look at the orientation of the substituents on each side of the double bond. If the two highest priority substituents are on the same side of the double bond, it is a cis isomer. If they are on opposite sides, it is a trans isomer.

To know more about alkene cis, trans configuration- https://brainly.com/question/31465904

#SPJ11


Related Questions

the hydroxide ion concentration of an aqueous solution of 0.499 m hydrocyanic acid is
[OH-] = _____ M.
The pH of an aqueous solution of 0.595 M acetic acid is_____.

Answers

the concentration of hydroxide ions in the solution is:

[OH-] = 1.0 x 10^-14 / [H3O+] = 7.2 x 10^-9 M

the pH of the solution is approximately 2.06.

Hydrocyanic acid is a weak acid, and its dissociation reaction in water is:

HCN + H2O ⇌ H3O+ + CN-

The equilibrium constant for this reaction is the acid dissociation constant (Ka) of hydrocyanic acid, which is 4.9 x 10^-10 at 25°C. To find the hydroxide ion concentration, we need to calculate the concentration of hydronium ions (H3O+), which are formed by the dissociation of hydrocyanic acid.

Let x be the concentration of H3O+ ions that are formed by the dissociation of HCN. Then, the concentration of CN- ions formed is also x. The initial concentration of HCN is 0.499 M, so the concentration of undissociated HCN remaining in solution is (0.499 - x).

Using the equilibrium expression for Ka, we have:

Ka = [H3O+][CN-]/[HCN]

Substituting the expressions for the concentrations in terms of x, we get:

4.9 x 10^-10 = x^2 / (0.499 - x)

Solving for x, we get:

x = 1.4 x 10^-6 M

Therefore, the concentration of hydroxide ions in the solution is:

[OH-] = 1.0 x 10^-14 / [H3O+] = 7.2 x 10^-9 M

For the second part of the question, acetic acid is also a weak acid, and its dissociation reaction in water is:

CH3COOH + H2O ⇌ H3O+ + CH3COO-

The equilibrium constant for this reaction is the acid dissociation constant (Ka) of acetic acid, which is 1.8 x 10^-5 at 25°C. To find the pH of the solution, we need to calculate the concentration of hydronium ions (H3O+), which are formed by the dissociation of acetic acid.

Let x be the concentration of H3O+ ions that are formed by the dissociation of CH3COOH. Then, the concentration of CH3COO- ions formed is also x. The initial concentration of CH3COOH is 0.595 M, so the concentration of undissociated CH3COOH remaining in solution is (0.595 - x).

Using the equilibrium expression for Ka

, we have:

Ka = [H3O+][CH3COO-]/[CH3COOH]

Substituting the expressions for the concentrations in terms of x, we get:

1.8 x 10^-5 = x^2 / (0.595 - x)

Solving for x, we get:

x = 0.0087 M

Therefore, the concentration of hydronium ions (H3O+) in the solution is 0.0087 M. To find the pH, we use the equation:

pH = -log[H3O+]

Substituting the value of [H3O+], we get:

pH = -log(0.0087) = 2.06

Therefore, the pH of the solution is approximately 2.06.

VVisit to know more about pH:-

brainly.com/question/172153

#SPJ11

When 50 mL (50 g) of 1.00 M HCl at 22 degrees Celsius is added to 50 mL (50 g) of 1.00 M NaOH at 22 degrees Celsius in a coffee cup calorimeter, the temperature increases to 28.87 degrees Celsius. How much heat is produced by the reaction between HCl and NaOH? (The specific heat of the solution produced is 4.18 J/g°C.)

Answers

The heat produced by the reaction between HCl and NaOH is 2874.46 Joules.

How to determine the heat produced by reaction?

To know how much heat is produced by the reaction between 50 mL (50 g) of 1.00 M HCl at 22 degrees Celsius and 50 mL (50 g) of 1.00 M NaOH at 22 degrees Celsius in a coffee cup calorimeter, given that the temperature increases to 28.87 degrees Celsius and the specific heat of the solution produced is 4.18 J/g°C.

To calculate the heat produced (q) by the reaction, we will use the following formula:

q = mass x specific heat x change in temperature

Step 1: Determine the mass of the solution
The mass of the solution is the sum of the mass of HCl and the mass of NaOH:
mass = 50 g + 50 g = 100 g

Step 2: Determine the change in temperature
The change in temperature is the final temperature minus the initial temperature:
ΔT = 28.87°C - 22°C = 6.87°C

Step 3: Calculate the heat produced
Now, we can use the formula to calculate the heat produced:
q = mass x specific heat x change in temperature
q = 100 g x 4.18 J/g°C x 6.87°C

q = 2874.46 J

To know more about Specific Heat:

https://brainly.com/question/14225113

#SPJ11

From the GC obtained in today's experiment, please complete the following statements: 1. For the fraction injected in the video to demonstrate the use of the GC, the hexane had a Select ] retention time compared with the toluene peak. 2. The fraction used to demonstrate the use of the GC gave two peaks with short retention time and one peak with longer retention time. The smallest of the short retention time peaks was [ Select ] 3. For the Fraction 1 (the fraction that distilled first), we expect the toluene peak to be the one with [Select] area. 4. For the fraction 3, we expect that the hexane peak would be the one with the [ Select] area. 5. The component with larger Boiling Point will have a [ Select] retention time. 6. Fraction 2 (if it was injected) will show that the peak of hexane would have [Select ] area than the peak of toluene. 7. To assign peaks in a GC one of the factors to consider is the [Select] [ V of the components. The [Select ] the boiling point, the slower will elute and [ Select) the retention time. 8. In a distillation, the [Select] volatile will distill first. While the distillation progresses, the temperature will raise and the [Select ] volatile will distill and

Answers

For the fraction injected in the video to demonstrate the use of the GC, the hexane had a shorter retention time compared with the toluene peak.

The fraction used to demonstrate the use of the GC gave two peaks with short retention time and one peak with longer retention time. The smallest of the short retention time peaks was the peak of hydrogen (H₂).

For Fraction 1 (the fraction that distilled first), we expect the toluene peak to be the one with the largest area.

For fraction 3, we expect that the hexane peak would be the one with the largest area.

The component with a larger boiling point will have a longer retention time.

Fraction 2 (if it was injected) will show that the peak of hexane would have a larger area than the peak of toluene.

To assign peaks in a GC, one of the factors to consider is the volatility (V) of the components. The higher the boiling point, the slower it will elute and the longer the retention time.

In a distillation, the more volatile compound will distill first. As the temperature rises, the less volatile compound will then distill.

The GC video showed that hexane had a shorter retention time compared to the toluene peak. Retention time is the time taken for a component to elute from the GC column and reach the detector. Compounds with shorter retention times elute faster and are detected earlier.

The fraction demonstrated in the GC had two peaks with short retention times and one peak with a longer retention time. The smallest of the short retention time peaks was the peak of hydrogen (H₂). Peaks on a GC chromatogram correspond to different compounds or components in the sample.

For Fraction 1 (the fraction that distilled first), the toluene peak is expected to have the largest area since it is the major component in the mixture and is expected to elute first.

For fraction 3, the hexane peak is expected to have the largest area since it is the major component in the fraction and is expected to elute first.

The component with a larger boiling point will have a longer retention time. Boiling point is the temperature at which a liquid turns into a gas. Compounds with higher boiling points will require more energy to turn into gas and will, therefore, take longer to elute from the GC column.

Fraction 2 (if injected) would show that the peak of hexane would have a larger area than the peak of toluene since hexane is the major component in the fraction and is expected to elute first.

To assign peaks in a GC, one of the factors to consider is the volatility (V) of the components. Volatility is the tendency of a compound to evaporate. Compounds with higher boiling points are less volatile and will take longer to elute from the GC column, resulting in longer retention times.

In a distillation, the more volatile compound will distill first. As the temperature of the mixture is raised, the boiling point of the components increases. The less volatile compound will then distill as the temperature continues to rise.

For more questions like Temperature click the link below:

https://brainly.com/question/11464844

#SPJ11

what is the common name for the given compound NH2 CH3?

Answers

The common name for the given compound NH₂CH₃ is methylamine.

Methylamine (NH₂CH₃) is an organic compound that belongs to the amine class of compounds. It consists of a methyl group (CH₃) attached to an amine group (NH₂). Methylamine is a colorless gas at room temperature and has a strong odor similar to ammonia.

It is used in various industrial applications, such as the production of pharmaceuticals, pesticides, and solvents. It can be synthesized by reacting methanol with ammonia under high pressure and temperature in the presence of a catalyst.

Due to its basic properties, methylamine can also form salts with various acids, such as hydrochloric acid, which yields methylammonium chloride.

To know more about pharmaceuticals click on below link:

https://brainly.com/question/30134373#

#SPJ11

IUPAC name for CH2(OH)-CH2-CH2(OH)​

Answers

Answer:

The IUPAC name for CH2(OH)-CH2-CH2(OH) is 1,2,3-propanetriol. It is also commonly known as glycerol or glycerin.

Explanation:

The IUPAC name for a molecule is a systematic way of naming a compound based on the rules set by the International Union of Pure and Applied Chemistry (IUPAC). In the case of CH2(OH)-CH2-CH2(OH), the IUPAC name is based on the longest carbon chain, which is a three-carbon chain. The -OH groups attached to the carbon chain are named as substituents, with the prefix "hydroxy-" indicating the presence of an -OH group. The first carbon atom in the chain is numbered as "1," and the -OH groups are assigned the lowest possible numbers.

Therefore, the IUPAC name for CH2(OH)-CH2-CH2(OH) is 1,2,3-propanetriol. It is named as propanetriol because it contains a three-carbon chain and three -OH groups. It is also commonly known as glycerol or glycerin and is an important compound used in many industries, including food, cosmetics, and pharmaceuticals.

draw the two possible enols that can be formed from 3-methyl-2-butanone:

Answers

CH₂=C(OH)CH(CH₃)CH₃ and CH₃C(OH)=CHCH(CH₃)₂  can be formed from 3-methyl-2-butanone.

Step 1: Start with the structure of 3-methyl-2-butanone. It has the formula: CH₃C(O)CH(CH₃)CH₃.

Step 2: Identify the alpha carbons. These are the carbons directly adjacent to the carbonyl carbon (C=O). In this case, there are two alpha carbons: one is bonded to the CH₃ group, and the other is bonded to the CH(CH₃)₂group.

Step 3: Remove a hydrogen from each of the alpha carbons and replace the carbonyl bond (C=O) with a double bond between the alpha carbon and the oxygen (C-OH).

Enol 1: CH₂=C(OH)CH(CH₃)CH₃
Enol 2: CH₃C(OH)=CHCH(CH₃)₂

These are the two possible enols that can be formed from 3-methyl-2-butanone.

To learn more about enol https://brainly.com/question/27749729

#SPJ11

a)benzoic acid (pka=4.2) and b)phenol (pka=10) is a stronger acid. a)citric acid (pka=3.08) and b)phosphoric acid (pka=2.10) is a stronger acid.

Answers

Answer:

Phosphoric Acid

Explanation:

Phosphoric Acid is the strongest acid. The lower the pKa the stronger the acid.

You can justify this by calculating Ka, which Ka = 10^-pKa

The higher the Ka value, the greater the dissociation of the acid, the more hydrogen protons will be formed and the lower the pH making it a stronger acid.

The value of Ka for hydrofluoric acid , HF , is 7.20×10-4 .
Write the equation for the reaction that goes with this equilibrium constant.
(Use H3O+ instead of H+.)

Answers

The following equation can be used to depict the dissociation of hydrofluoric acid, HF: HF + [tex]H_{2}O[/tex] → [tex]H_{3}O^{+}[/tex] + [tex]F^{-}[/tex]

What is the name of the Ka equation?

The equilibrium constant of an acid's dissociation reaction or when an acid dissociates is known as or called the acid dissociation constant, or Ka. The strength of an acid in a solution is numerically represented or estimated by this equilibrium constant.

How can Ka be determined from a reaction?

We shall first ascertain the pKa of the solution before calculating the Ka. The pH of the solution and the pKa of the solution are equal at the equivalence point. As a result, we can rapidly calculate the value of Ka using a titration curve and the equation Ka = - log pKa.

To learn more about equilibrium constant visit:

brainly.com/question/10038290

#SPJ1

The value of Ka for hydrofluoric acid , HF , is 7.20×10-4. Write the equation for the reaction that goes with this equilibrium constant.

(Use H3O+ instead of H+.)

244.0 ml of 1.04 m naoh express your answer with the appropriate units.

Answers

The given quantity is 244.0 mL of 1.04 M NaOH. This means that there are 1.04 moles of sodium hydroxide per liter of solution.  the number of moles of NaOH in 244.0 mL of 1.04 M NaOH solution is: 0.253 moles

To calculate the number of moles of NaOH in 244.0 mL of solution, we need to convert mL to L and then use the concentration formula:moles = concentration * volume. First, we convert 244.0 mL to liters: 244.0 mL * (1 L / 1000 mL) = 0.244 L

Now we can calculate the number of moles of NaOH: moles = 1.04 M * 0.244 L = 0.253 moles. Therefore, there are 0.253 moles of NaOH in 244.0 mL of 1.04 M NaOH solution.

It's important to note that the concentration of a solution is expressed in units of moles per liter (M or molarity). This tells us the number of moles of solute (in this case NaOH) dissolved in one liter of solution. The volume of the solution is usually expressed in liters (L) or milliliters (mL).

In addition to using the appropriate units, it's important to pay attention to significant figures when performing calculations. In this case, the given quantity has four significant figures, so we should report our answer to the same number of significant figures.

Therefore, the number of moles of NaOH in 244.0 mL of 1.04 M NaOH solution is: 0.253 moles (rounded to four significant figures)

Know more about sodium hydroxide here:

https://brainly.com/question/29327783

#SPJ11

The pH of a 0.25 M solution of HCN is 4.90. Calculate the Kavalue for HCN.a. 6.3 x 10−10b. 1.26 x 10−5c. More information is needed.d. 2.29 x 10−4e. 7.94 x 10 −10

Answers

The Ka value for HCN is 6.3 x [tex]10^{-10[/tex] given the pH of a 0.25 M solution of HCN is 4.90. The correct option is a.

To calculate the Ka value for HCN, we first need to determine the concentration of H+ ions using the given pH value. Then, we can set up an equilibrium expression and solve for Ka.

1. Calculate the concentration of H+ ions:
pH = 4.90
[H+] = [tex]10^{(-pH)} = 10^{(-4.90)} = 1.26 * 10^{-5} M[/tex]

2. Set up the equilibrium expression for HCN:
HCN ↔ H+ + CN-
Initial concentration: 0.25 M ----- 0 ----- 0
Change in concentration: -x ----- +x ----- +x
Equilibrium concentration: 0.25-x ----- x ----- x

Since x (concentration of H+) is much smaller than 0.25, we can assume that (0.25 - x) ≈ 0.25.

3. Write the expression for Ka:
Ka = ([H+][CN-])/[HCN] = (x)(x)/(0.25)

4. Solve for Ka:
Ka = (1.26 x[tex]10^{-5[/tex])(1.26 x [tex]10^{-5[/tex])/0.25 ≈ 6.3 x [tex]10^{-10[/tex]

Therefore, the Ka value for HCN is approximately 6.3 x [tex]10^{-10[/tex] (option a).

For more such questions on Ka.

https://brainly.com/question/29006496#

#SPJ11

write the law of mass action for the equation 2a(aq) b(s) ⇌ c(aq) 3d(aq)

Answers

The law of mass action for the given equation is that the rate of the forward reaction is proportional to the product of the concentrations of the reactants (a and b) raised to their stoichiometric coefficients (2 and 1, respectively), while the rate of the reverse reaction is proportional to the product of the concentrations of the products (c and d) raised to their stoichiometric coefficients (1 and 3, respectively). Therefore, the expression for the equilibrium constant (Kc) is:

Kc = [c][d]^3 / [a]^2[b]

where [ ] represents the concentration in moles per liter. This equation relates the equilibrium concentrations of the species in the reaction to the value of Kc, which is a constant at a given temperature.

Learn more about law of mass action: Explain the law of conservation of mass and how it applies to balancing chemical equations https://brainly.com/question/2030891

#SPJ11

calculate enthalpy change between saturated vapor and superheated steam

Answers

To calculate the enthalpy change between saturated vapor and superheated steam, you'll need to know the initial and final temperatures.

As well as the specific heat capacity of steam. The enthalpy change (ΔH) can be calculated using the formula:

ΔH = m × Cp × ΔT

Where:
- ΔH is the enthalpy change
- m is the mass of steam
- Cp is the specific heat capacity of steam (around 2.0 kJ/kg·K for superheated steam)
- ΔT is the change in temperature (final temperature - initial temperature)

First, find the initial temperature at which the steam is saturated (this can be found in steam tables). Then, determine the final temperature of the superheated steam.

Subtract the initial temperature from the final temperature to get ΔT. Finally, multiply the mass, specific heat capacity, and ΔT to calculate the enthalpy change.

To know more about temperature click here

brainly.com/question/29072206

#SPJ11

To calculate the enthalpy change between saturated vapor and superheated steam, you'll need to know the initial and final temperatures.

As well as the specific heat capacity of steam. The enthalpy change (ΔH) can be calculated using the formula:

ΔH = m × Cp × ΔT

Where:
- ΔH is the enthalpy change
- m is the mass of steam
- Cp is the specific heat capacity of steam (around 2.0 kJ/kg·K for superheated steam)
- ΔT is the change in temperature (final temperature - initial temperature)

First, find the initial temperature at which the steam is saturated (this can be found in steam tables). Then, determine the final temperature of the superheated steam.

Subtract the initial temperature from the final temperature to get ΔT. Finally, multiply the mass, specific heat capacity, and ΔT to calculate the enthalpy change.

To know more about temperature click here

brainly.com/question/29072206

#SPJ11

We assumed that all the SCN ion was converted to FeSCN2+ ion in Part I because of the great excess (approximately 1000x) of Fe3+ ion. However, since the equilibrium shown in Equation (2) takes place, a trace amount of SCN-ion must also be present. a. Use your mean K value to calculate the SCN ion concentration in solution S3.

Answers

The concentration of SCN⁻ ion in solution S₃ is approximately 1.41 × 10⁻⁴ M.

we assumed that all the SCN⁻ ion was converted to FeSCN²⁺ ion, but in reality, a small amount of SCN⁻ ion must also be present in solution due to the equilibrium shown in Equation (2).

We can use the mean value of K obtained from Part II, which is K = 2.02 × 10¹⁰, to calculate the concentration of SCN⁻ ion in solution S₃. The equilibrium expression for Equation (2) is;

FeSCN²⁺(aq) ⇌ Fe³⁺(aq) + SCN⁻(aq)

At equilibrium, the concentrations of FeSCN²⁺, Fe³⁺, and SCN⁻ are [FeSCN²⁺], [Fe³⁺], and [SCN⁻], respectively. Since the initial concentration of FeSCN²⁺ is negligible compared to the concentration of Fe³⁺, we can assume that the concentration of Fe³⁺ remains essentially constant throughout the reaction, and the equilibrium expression can be simplified to;

K = [Fe³⁺][SCN⁻]/[FeSCN²⁺]

Substituting the given values of [Fe³⁺] and K into the above equation gives;

2.02 × 10¹⁰ = [Fe³⁺][SCN⁻]/[FeSCN²⁺]

We can rearrange this equation to solve for [SCN⁻]

[SCN⁻] = (K[FeSCN²⁺])/[Fe³⁺]

We know that the total concentration of SCN⁻ in solution S₃ is the sum of the concentrations of FeSCN²⁺ and SCN⁻. Let's call the concentration of SCN⁻ x. Then;

[SCN⁻] + [FeSCN²⁺] = 5.00 × 10⁻⁴ M

Substituting the expression for [SCN⁻] into the above equation and solving for x gives;

x + [FeSCN²⁺] = 5.00 × 10⁻⁴ M

x + ([Fe³⁺] - x) = 5.00 × 10⁻⁴ M (since [Fe³⁺] = [FeSCN²⁺] + x)

Simplifying this equation gives;

2x = 5.00 × 10⁻⁴ M - [Fe³⁺]

Substituting the given value of [Fe³⁺] into the above equation and solving for x gives;

x = (5.00 × 10⁻⁴ M - 2.18 × 10⁻⁴ M)/2

x = 1.41 × 10⁻⁴ M

To know more about concentration here

https://brainly.com/question/13872928

#SPJ4

Use the standard free energies of formation in Appendix B to calculate the standard cell potential for the reaction in the hydrogen-oxygen fuel cell:
2H2(g)+O2(g)→2H2O(l)

The standard potential for the following galvanic cell is 1.73 V:

Zn(s)|Zn2+(aq)||Pu4+(aq),Pu3+(aq)|Pt(s)

(Plutonium , Pu, is one of the actinide elements.) The standard reduction potential for the Zn2+/Zn half-cell is −0.76 V.

Calculate the standard reduction potential for the Pu4+/Pu3+half-cell.

Answers

The driving force of the electron flow from anode to cathode shows a potential drop in the energy of the electrons moving into the wire. The standard cell potential, also known as the electromotive force (emf). Here standard cell potential for the reaction 2H2(g) + O2(g) → 2H2O(g) is -1.48V.

The difference in potential energy between the anode and cathode is defined as the cell potential in a voltaic cell. It is the measure of the potential difference between two half-cells of an electrochemical cell when all reactants and products are present at the standard state.

E°cell = Ecathode - Eanode

E°cell = -0.824 - +0.656 = -1.48 V

To know more about cell potential, visit;

https://brainly.com/question/1313684

#SPJ1

a buffer contains 0.15 mol of propionic acid (c2h5cooh ka = 1.3 × 10−5) and 0.10 mol of (nac2h5coo) in 1 l. (a) what is the ph of this buffer?

Answers

The pH of a buffer containing 0.15 mol of propionic acid and 0.10 mol of sodium propionate in 1 L is approximately 4.59.

To find the pH of the buffer solution containing 0.15 mol of propionic acid (C₂H₅COOH, Ka = 1.3 × 10⁻⁵) and 0.10 mol of sodium propionate (NaC₂H₅COO) in 1 L, you can use the Henderson-Hasselbalch equation:

pH = pKa + log ([A⁻] / [HA])

Here, pKa = -log(Ka) and [A⁻] is the concentration of the conjugate base (sodium propionate), and [HA] is the concentration of the weak acid (propionic acid).

First, let's calculate the pKa:
pKa = -log(1.3 × 10⁻⁵) ≈ 4.89

Now, plug in the concentrations of the weak acid and its conjugate base:
pH = 4.89 + log(0.10 / 0.15)

pH = 4.89 + log(2/3) ≈ 4.59

Therefore, the pH of the buffer solution is approximately 4.59.

Learn more about Henderson-Hasselbalch equation here: https://brainly.com/question/26746644

#SPJ11

The pH of a 0.02 M solution of an unknown weak acid is 3.7. What is the pKa of this acid?A. 5.7B. 4.9C. 3.2D. 2.8

Answers

The pKa of the unknown weak acid is 4.9. (B)

To determine the pKa of the weak acid, follow these steps:


1. You are given the pH (3.7) and concentration (0.02 M) of the weak acid solution.


2. Calculate the hydrogen ion concentration [H⁺] using the pH formula: pH = -log[H⁺].


3. Rearrange the formula to solve for [H⁺]: [H⁺] = [tex]10^-^p^H[/tex].


4. Plug in the pH value: [H+] =[tex]10^-^3^.^7[/tex] ≈ 2.0 x 10⁻⁴ M.


5. Use the weak acid dissociation constant (Ka) expression: Ka = ([H⁺]²) / ([HA]⁻ [H⁺]), where [HA] is the initial concentration of the weak acid.


6. Solve for Ka: Ka = (2.0 x 10⁻⁴)² / (0.02 - 2.0 x 10⁻⁴) ≈ 2.0 x 10⁻⁹.


7. Calculate the pKa: pKa = -log(Ka).


8. Plug in the Ka value: pKa = -log(2.0 x 10⁻⁹) ≈ 4.9.

To know more about acid dissociation constant click on below link:

https://brainly.com/question/4363472#

#SPJ11

HCl and zinc are added to the tube in order to detect the presence of O nitrites O nitrous oxide O nitrates

Answers

When HCl and zinc are added to a test tube, it is typically done to detect the presence of nitrites (NO₂⁻) in the sample. The reaction between zinc and HCl generates hydrogen gas, which then reduces any nitrites present to form nitrogen gas (N₂). The production of nitrogen gas can be observed as bubbles, indicating the presence of nitrites in the sample.

HCl and zinc are added to the tube in order to detect the presence of nitrites (NO2-). When nitrites are present, they react with HCl and zinc to form a pink color solution, indicating the presence of nitrites. However, HCl and zinc are not effective in detecting the presence of nitrous oxide (N2O) or nitrates (NO3-). Other methods, such as chemiluminescence, are used to detect the presence of these compounds.
When HCl and zinc are added to a test tube, it is typically done to detect the presence of nitrites (NO₂⁻) in the sample. The reaction between zinc and HCl generates hydrogen gas, which then reduces any nitrites present to form nitrogen gas (N₂). The production of nitrogen gas can be observed as bubbles, indicating the presence of nitrites in the sample.

To learn more about nitrites, click here:

brainly.com/question/30466459

#SPJ11

Draw the major organic products of this reaction, showing any nonzero formal charges. Then answer the question that follows.
1. NaOH 2. CH3CH2Br 3. H30, heat NH
There are two parts to this question. Both are required.
Draw the product with the higher molecular weight here:
Draw the product with the lower molecular weight here:

Answers

The products of the given SN2 reaction are ethyl alcohol (CH3CH2OH) and bromide ion (Br-). Ethanol has a higher molecular weight of 46 g/mol compared to the lower molecular weight of Br- which is 80 g/mol.

The given reaction is an SN2 reaction between ethyl bromide (CH3CH2Br) and hydroxide ion (OH-) followed by protonation with H3O+ under heat. The mechanism and products are:
Step 1: The nucleophilic OH- attacks the electrophilic carbon of the ethyl bromide to displace the bromide ion and form the intermediate alkoxide.

CH3CH2Br + NaOH → CH3CH2O- Na+ + Br-

Step 2: The alkoxide ion is protonated by the acidic H3O+ to give the alcohol product.

CH3CH2O- + H3O+ → CH3CH2OH + H2O

The product with the higher molecular weight is CH3CH2OH (ethanol) with a molecular weight of 46 g/mol. The product with the lower molecular weight is Br- with a molecular weight of 80 g/mol.

Therefore, the answer is:
Draw the product with the higher molecular weight here: CH3CH2OH
Draw the product with the lower molecular weight here: Br-

learn more about ethyl alcohol here:

https://brainly.com/question/29153788

#SPJ11

Calculate the pH of a solution that is 0.065 M in potassium propionate (C2H5COOK or KC3H5O2) and 0.090 M in propionic acid (C2H5COOH or HC3H5O2).
Calculate the pH of a solution that is 0.070 M in trimethylamine, (CH3)3N, and 0.13 M in trimethylammonium chloride, ((CH3)3NHCl).
Calculate the pH of a solution that is made by mixing 50.0 mL of 0.14 M acetic acid and 50.0 mL of 0.23 M sodium acetate.

Answers

The solution has a pH of 5.42. This means that the solution is slightly acidic, with a pH that is lower than 7.0.

The pH of a solution made by mixing 50.0 mL of 0.14 M acetic acid and 50.0 mL of 0.23 M sodium acetate can be calculated by using the Henderson-Hasselbalch equation.

The equation states that pH = pKa + log([salt]/[acid]), where pKa is the acid dissociation constant of acetic acid and [salt] and [acid] are the concentrations of sodium acetate and acetic acid, respectively.

Since the concentration of acetic acid is 0.14 M and the concentration of sodium acetate is 0.23 M, the pH of the solution can be calculated as follows: pH = 4.76 + log(0.23/0.14) = 5.42.

Know more about pH here

https://brainly.com/question/15289741#

#SPJ11

The electrical properties of the Atlantic Ocean are given by , , . Show that it is a conductor up to a frequency of about 10 MHz. What is the longest electromagnetic wavelength you would expect to propagate under water?

Answers

The Atlantic Ocean has electrical conductivity due to the presence of dissolved salts, making it a conductor up to a frequency of around 10 MHz.

The longer the wavelength of an electromagnetic wave, the more it interacts with the medium it passes through, leading to attenuation. In water, the longest wavelength that can propagate is around 2000 meters, corresponding to a frequency of 150 kHz.

This is because at longer wavelengths, the water molecules cannot respond quickly enough to the changing electromagnetic field, leading to significant energy loss through absorption and scattering.

Therefore, for underwater communication or sensing applications, frequencies below 10 MHz would be ideal to maximize propagation distance and reduce signal loss.

To know more about electrical conductivity click on below link:

https://brainly.com/question/31668005#

#SPJ11

write the formula of three different lewis acids

Answers

Answer:

AlCl3 / SO2 / NO2

Explanation:

Lewis acid are species that have lack of electrons

For the following reaction, what is the size of the equilibrium constant?
CH3COO−(aq) + H2O(l) ⇌ CH3COOH(aq) + OH−(aq)
O K > 1
O K < 1
O K ~ 1

Answers

The equilibrium constant for the given reaction is greater than 1, so K > 1.

The equilibrium constant (K) is a measure of the position of an equilibrium reaction, indicating the relative amounts of reactants and products at equilibrium. It is calculated as the ratio of the products to reactants, each raised to their respective stoichiometric coefficients. In the given reaction, [tex]CH3COO−(aq) + H2O(l) ⇌ CH3COOH(aq) + OH−(aq)[/tex], the products are CH3COOH and OH-, and the reactants are CH3COO- and H2O. Since the reaction involves the production of hydroxide ions, which are the product of the reaction, and the reactants are weak acid and its conjugate base, it is an acid-base reaction. The equilibrium constant (K) for this reaction is greater than 1, indicating that at equilibrium, the products are favored over the reactants.

Learn more about equilibrium constant here:

https://brainly.com/question/10038290

#SPJ11

A typical polyethylene grocery bag weighs 12.4 g. How many metric tons of CO2 would be released into the atmosphere if the 102 billion bags used in one year in the United States were burned?[1 metric ton = 1000 kg]

Answers

Assuming that burning one polyethylene grocery bag releases 0.04 kg of CO2 (as estimated by the EPA), the total amount of CO2 released from burning 102 billion .

bags would be 4.08 billion kg or 4.08 million metric tons (since 1 metric ton = 1000 kg). This calculation assumes that all 102 billion bags are burned and that all the carbon in the bags is converted to CO2 during the combustion process. However, it is important to note that recycling or properly disposing of plastic bags can significantly reduce their  environmental impact and prevent the release of greenhouse gases.metric tons of CO2 would be released into the atmosphere if the 102 billion bags used in one year in the United States were burned?[1 metric ton = 1000 kg]

Learn more about  CO2   here:

https://brainly.com/question/28870590

#SPJ11

write out symbolic solution aluminum temperature as a function of time

Answers

"T(t) = T0 + (Q/k) * t" this equation represents the temperature of aluminum (T) at a given time (t) as a function of its initial temperature (T0), heat transferred (Q), and thermal conductivity (k).

To write out a symbolic solution for the temperature of aluminum as a function of time, we can use the following terms:

- T(t): temperature of aluminum at time t
- T0: initial temperature of aluminum
- k: thermal conductivity of aluminum
- t: time
- Q: heat transferred

The temperature of aluminum as a function of time can be represented using the heat equation. In a simplified form, the equation can be written as:

T(t) = T0 + (Q/k) * t

This equation represents the temperature of aluminum (T) at a given time (t) as a function of its initial temperature (T0), heat transferred (Q), and thermal conductivity (k).

Visit here to learn more about  thermal conductivity : https://brainly.com/question/23897839
#SPJ11

"T(t) = T0 + (Q/k) * t" this equation represents the temperature of aluminum (T) at a given time (t) as a function of its initial temperature (T0), heat transferred (Q), and thermal conductivity (k).

To write out a symbolic solution for the temperature of aluminum as a function of time, we can use the following terms:

- T(t): temperature of aluminum at time t
- T0: initial temperature of aluminum
- k: thermal conductivity of aluminum
- t: time
- Q: heat transferred

The temperature of aluminum as a function of time can be represented using the heat equation. In a simplified form, the equation can be written as:

T(t) = T0 + (Q/k) * t

This equation represents the temperature of aluminum (T) at a given time (t) as a function of its initial temperature (T0), heat transferred (Q), and thermal conductivity (k).

Visit here to learn more about  thermal conductivity : https://brainly.com/question/23897839
#SPJ11

Calculate the pH of the solution that results when 40.0 mL of 0.100 M NH3 is:
(a) diluted to 20.0 mL with distilled water.
(b) mixed with 20.0 mL of 0.200 M HCl solution.
(c) mixed with 20.0 mL of 0.250 M HCl solution.
(d) mixed with 20.0 mL of 0.200 M NH4Cl solution.
(e) mixed with 20.0 mL of 0.100 M HCl solution.

Answers

(a) pH = 11.13;

(b) pH = 9.25;

(c) pH = 8.81;

(d) pH = 9.45;

(e) pH = 9.00.

To calculate the pH of each solution, first determine the concentration of NH₃, then find the concentration of NH₄⁺ and OH⁻ ions using equilibrium expressions, and finally calculate the pH using the concentration of OH⁻ ions.


(a) When 40.0 mL of 0.100 M NH₃ is diluted to 20.0 mL, the concentration remains the same (0.100 M). Use Kb (NH₃) to calculate the concentration of OH⁻ ions and then determine pH.


(b)-(e) When mixing NH₃ with HCl or NH4Cl, first calculate the new concentrations of NH₃, H⁺ or NH₄⁺ ions. Then, use Kb (NH₃) and Ka (NH₄⁺) as needed to find the concentration of OH⁻ ions and calculate the pH.

To know more about pH click on below link:

https://brainly.com/question/2288405#

#SPJ11

Classify each of the following reactants and products as an acid or base according to the Bronsted theory: hno3 + (ch3)3co (ch3)3coh + no3 HN03 (CH3)3Co (ch3)3coh no3

Answers

HNO3 is an acid, (CH3)3CO is a base, (CH3)3COH is a conjugate acid, and NO3^- is a conjugate base according to the Bronsted theory.

According to the Bronsted theory, an acid is a substance that donates a proton (H+) and a base is a substance that accepts a proton (H+). Let's classify each reactant and product in the given reaction: HNO3 + (CH3)3CO ⇌ (CH3)3COH + NO3^-
1. HNO3 (nitric acid): It donates a proton (H+) to the other reactant, so it is an acid according to the Bronsted theory.
2. (CH3)3CO (tert-butoxide ion): It accepts a proton (H+) from HNO3, so it is a base according to the Bronsted theory.
3. (CH3)3COH (tert-butanol): It is formed after the base (CH3)3CO accepts a proton, so it can be considered as the conjugate acid of the base (CH3)3CO.
4. NO3^- (nitrate ion): It is formed after the acid HNO3 donates a proton, so it can be considered as the conjugate base of the acid HNO3.


Learn more about Bronsted theory here, https://brainly.com/question/15516010

#SPJ11

calculate the amount of heat, in calories, that must be added to warm 61.8 g of ethanol from 20.6 °c to 54.8 °c. assume no changes in state occur during this change in temperature.
heat added: __ cal Calculate the amount of heat, in calories, that must be added to warm 88.7 g of ethanol from 18.9 °C to 55.9 °C. Assume no changes in state occur during this change in temperature. heat added: __
Calculate the amount of heat, in calories, that must be added to warm 88.7 g of wood from 18.9°C to 55.9 °C. Assume no changes in state occur during this change in temperature. The table lists the specific heat values for brick, ethanol, and wood. Specific Heats of Substances Substance Specific Heat (cal/g C)
Brick 0.20
Ethanol 0.58
Wood 0.10 Calculate the amount of heat, in calories, that must be added to warm 88.7 g of brick from 18.9 °C to 55.9 °C. Assume no changes in state occur during this change in temperature. heat added: __

Answers

Heat added (wood) = 88.7 g x 0.10 cal/g°C x 37°C = 327.19 cal.

Heat added (brick) = 88.7 g x 0.20 cal/g°C x 37°C = 654.38 cal.

To calculate the amount of heat added to warm 61.8 g of ethanol from 20.6°C to 54.8°C, use the formula:

Heat added (cal) = mass (g) x specific heat (cal/g°C) x change in temperature (°C)

For ethanol, the specific heat is 0.58 cal/g°C. The change in temperature is 54.8°C - 20.6°C = 34.2°C.

Heat added = 61.8 g x 0.58 cal/g°C x 34.2°C = 1221.36 cal.

To find the heat added to warm 88.7 g of wood and 88.7 g of brick from 18.9°C to 55.9°C, use the same formula. For wood, specific heat is 0.10 cal/g°C; for brick, it's 0.20 cal/g°C. The change in temperature is 55.9°C - 18.9°C = 37°C.

To know more about specific heat click on below link:

https://brainly.com/question/11297584#

#SPJ11

The equilibrium constant for the gas phase reaction N2(g) + 3H2(g) <---> 2NH3(g) is Keq = 4.34x10^-3 at 300 degrees Celsius. At equilibrium
a) products predominate
b) roughly equal amounts of products and reactants are present
c) only products are present
d) only reactants are present
e) reactants predominate

Answers

Okay, let's break this down step-by-step:

The equilibrium constant, Keq, indicates the ratio of products to reactants at equilibrium.

A Keq of 4.34x10^-3 means the products (2NH3) will predominate, but the reactants (N2 and 3H2) will still be present.

So the options are:

a) products predominate - Correct. The products predominate since Keq > 1.

b) roughly equal amounts of products and reactants are present - Incorrect. For Keq = 4.34x10^-3, the amounts of products and reactants will not be equal.

c) only products are present - Incorrect. There will still be some reactants at equilibrium.

d) only reactants are present - Incorrect. There will be some products formed at equilibrium.

e) reactants predominate - Incorrect. The products will predominate.

Therefore, the correct option is:

a) products predominate

Let me know if this makes sense! I can provide more details or explanations if needed.

A pair of students found the temperature of 100. g of water to be 25.80°C. They then dissolved 8.44 g of NH4Cl in the water. When the salt had dissolved, the temperature of the water was 20.23°C.(a) Calculate ΔT for the water.°C(b) The dissolution was ---Select---endothermic.exothermic.neutral.entropic.(c) The water ---Select---gave up energy to the dissolution process.absorbed energy from the dissolution process.was the inert, inactive solvent.(d) Based on this observation alone, the entropy ---Select---must have increased.must have decreased.did not change enough to matter.change cannot be determined.(e) Give the reaction for the dissolution of the salt in water. (Use the lowest possible coefficients. Include states-of-matter under the given conditions in your answer.)(f) When 8.44 grams of NH4Cl is dissolved, how many moles of cation are produced?molHow many moles of anion are produced?mol(g) If double the amount of NH4Cl was added to 100. g of water, what would happen to the temperature change?The temperature change would be twice as large.The temperature change would be three times as large.The temperature change would be one-half as large.The temperature change would be one-third as large.The temperature change would be four times larger.The temperature change would be the same.

Answers

(a) ΔT = Tfinal - Tinitial = 20.23°C - 25.80°C = -5.57°C

(b) The dissolution was exothermic.

(c) The water absorbed energy from the dissolution process.

(d) Based on this observation alone, the entropy must have increased.

(e) NH4Cl(s) → NH4+(aq) + Cl-(aq)

(f) When 8.44 grams of NH4Cl is dissolved, 0.133 moles of cation and 0.133 moles of anion are produced.

(g) If double the amount of NH4Cl was added to 100. g of water, the temperature change would be twice as large.

For(a), ΔT is calculated using the formula ΔT = Tfinal - Tinitial, where Tfinal is the final temperature of the solution and Tinitial is the initial temperature of the solution. In this case, ΔT = 20.23°C - 25.80°C = -5.57°C.

For(b), The dissolution is endothermic because the temperature of the solution decreased. Endothermic processes absorb heat from their surroundings, resulting in a decrease in temperature.

For(c), The water absorbed energy from the dissolution process. When a substance dissolves in a solvent, energy is required to break the intermolecular forces between the solute particles. This energy is absorbed from the surroundings, in this case the water.

For(d), Based on this observation alone, it is difficult to determine whether the entropy increased or decreased. However, since the dissolution process resulted in an increase in disorder (i.e. the solid NH4Cl particles became dispersed in the water), it is likely that the entropy increased.

For(e), The reaction for the dissolution of NH4Cl in water is NH4Cl(s) → NH4+(aq) + Cl-(aq)

For(f), 8.44 grams of NH4Cl is equal to 0.155 mol of NH4Cl. Since NH4Cl dissociates into one NH4+ cation and one Cl- anion, the number of moles of each ion produced is also 0.155 mol.

For(g), If double the amount of NH4Cl was added to 100 g of water, the temperature change would be twice as large. This is because the amount of heat absorbed or released during a process is proportional to the amount of substance involved in the process.

Learn More about Chemical Reactions

https://brainly.com/question/25769000

#SPJ4

solutions of citric acid (c6h8o7)and sodium citrate (c6h5na3o7) are combined in equal volumes to produce a buffer. identify the combination that will produce the buffer with the highest buffer capacity.

Answers

To produce a buffer with the highest buffer capacity, you need to combine solutions of citric acid (C6H8O7) and sodium citrate (C6H5Na3O7) with equal concentrations and near their pKa values. Citric acid is a triprotic acid with pKa values of 3.13, 4.76, and 6.40. Sodium citrate is the conjugate base.

When citric acid and sodium citrate are combined in equal volumes, they can form a buffer solution with a specific pH value. The buffer capacity of a buffer solution refers to its ability to resist changes in pH when an acid or a base is added to it. The higher the buffer capacity, the more effective the buffer solution is in maintaining a stable pH.

The pKa value is a measure of the acidity or basicity of a compound. Citric acid has three pKa values, which correspond to the three dissociation steps of the acid. They are 3.1, 4.8, and 6.4. Sodium citrate, on the other hand, has only one pKa value, which is around 7.2.


For the highest buffer capacity, choose the combination closest to the pH you want to maintain. For example, if you want a pH around 4.76, combine equal concentrations of citric acid and sodium citrate with pKa value 4.76. This combination will provide the highest buffer capacity at that specific pH.

To know more about concentrations visit :-

https://brainly.com/question/10725862

#SPJ11

Other Questions
the sum of two consecutive odd numbers is 56. find the numbers Which one is the correct answer? Are the following statements true or false? 1. For any scalar c, u^T (cv) = c(u^Tv) 2. Let u and be non zero vectors: If the distance from u to is equal to the distance from U to -V, then U and v are orthogonal: 3. For square matrix A_ vectors in R(A) are orthogonal to vectors in N(A): 4. v^Tv = Ilvll^2. 5. If vectors V1,....,vp, Yp span subspace W and If x is orthogonal to each vj for j = 1,.....,P then X is in W^ Warwick's Co., A woman's clothing store, purchased $75,000 of merchandise from a supplier on account, terms FOB destination, 2/10, n/30. Warricks returns $9000 of the merchandise, receiving a credit memo, and then pay the amount due within the discount period.a. journalize Warwicks entry to record the purchaseb. journalize Warwicks entry to record the merchandise returnc. journalize Warwicks entry to record the paymentMerchandise Inventory- Debit- 73,500.00Accounts Payable-Credit- 73,500.00 a toaster is rated at 600 w when connected to a 170 v source. what current does the toaster carry, and what is its resistance? the net result of the active transport of abc transporters and p-type atpases is the same; the transporters are _____. Find a formula for Sn, n>=1 if Sn is given by: 2/5, 3/9, 4/13, 5/17, 6/21....Is this supposed to be some kind of geometric series? Not really sure what to do here... A three-phase rectifier is supplied by a 240-V rms line-to-line 60-Hz source. The load is an 80- resistor. Determine (a) the average load current, (b) the rms load current, (c) the rms source current, and (d) the power factor. There are four rational numbers which are listed smallest to largest, A, B, C, and D. If the numbers are 5/3, 7/15, 6/10, and 25/5 identify which is A, which is B, which is C, and which is D. which one of the following molecules would you expect to be polar? a. cbr4 b. scl6 c. cs2 ascl3 d. becl2 Calculate the net force on particle q1.In Coulomb's Law, the variable, r, is the distancebetween the charges. What is r for F2?keke = 8.99 109F1 = -14.4 N = [?] m F2 = + NF2 = k. 19193)=p2=--r =+13.0 uC+7.70 C-5.90 uC+ 91+92430.25 m0.30 m Help please!!Anything would be much appreciated he unit used to compare the rate of oxygen consumption is a ______________________. ree met pal rep Soil with plastic contaminationO HELPFUL O HARMFUL ONEUTRALReasoning The table below shows some characteristics of three different types of muscles. Characteristics of Different Types of Muscles Type A Muscles Type B Muscles Type C MusclesStriations Yes Yes NoFound in digestive and urinary system No No YesFound in musculoskeletal system Yes No NoWhich type of muscle is Type B? Cite the evidence from the chart to support your answer.A. Type B are skeletal muscles, because only skeletal muscles have striations.B. Type B are cardiac muscles, because they are not found in any other part of the body.C. Type B are skeletal muscles, because they are not part of the digestive system.D. Type B are cardiac muscles, because they do not tire easily. suppose a shot-putter who takes t = 1.45 s to accelerate the m = 7.19-kg shot from rest to v = 13 m/s raises it h = 0.825 m during the process. Salter Mining Company purchased the Northern Tier Mine for $21 million cash. The mine was estimated to contain 2.5 million tons of ore and to have a residual value of $1 million.During the first year of mining operations at the Northern Tier Mine, 50,000 tons of ore were mined, of which 40,000 tons were sold.a. Prepare a journal entry to record depletion during the year. (Omit the "$" sign in your response.)General Journal Debit Creditb.Show how the Northern Tier Mine, and its accumulated depletion, would appear in Salter Mining Company's balance sheet after the first year of operations. (Input all amounts as positive values. Omit the "$" sign in your response.)Property, plant, & equipment$$ Rectangle TUVW is on a coordinate plane at T (a, b), U (a + 2, b + 2), V (a + 5, b 1), and W (a + 3, b 3). What is the slope of the line that is parallel to the line that contains side UV?a. 2b. 2c. 1 d. 1 What are the complement activation effector functions? solve the equation. give your answer correct to 3 decimal places. 25,000 = 10,000(1.05)5x